17α-Dihydroequilinのソースを表示

{{Short description|Chemical compound}}
{{Distinguish|17β-Dihydroequilin|17α-Dihydroequilenin|17β-Dihydroequilenin}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = (9''S'',13''S'',14''S'',17''R'')-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[''a'']phenanthrene-3,17-diol
| image = 17α Dihydroequilin.svg
| width = 225px

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = [[Oral administration|By mouth]]
| class = [[Estrogen (medication)|Estrogen]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 

<!--Identifiers-->
| CAS_number_Ref = 
| CAS_number = 651-55-8
| CAS_supplemental = 
| ATC_prefix = G03
| ATC_suffix = CA57
| PubChem = 9547222
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 7826162
| UNII = 48P73794OJ
| synonyms = α-Dihydroequilin; 7-Dehydro-17α-estradiol; Estra-1,3,5(10),7-tetraen-3,17α-diol

<!--Chemical data-->
| C=18 | H=22 | O=2
| SMILES = CC12CCC3C(=CCC4=C3C=CC(=C4)O)C1CCC2O
| StdInChI_Ref = 
| StdInChI = 1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3-5,10,14,16-17,19-20H,2,6-9H2,1H3/t14-,16+,17-,18+/m1/s1
| StdInChIKey_Ref = 
| StdInChIKey = NLLMJANWPUQQTA-SPUZQDLCSA-N
}}

'''17α-Dihydroequilin''', or '''α-dihydroequilin''', also known as '''7-dehydro-17α-estradiol''', as well as '''estra-1,3,5(10),7-tetraene-3,17α-diol''', is a [[natural product|naturally occurring]] [[steroid]]al [[estrogen (medication)|estrogen]] found in [[equine|horse]]s which is closely related to [[equilin]], [[equilenin]], and [[17α-estradiol]].<ref name="FritzSperoff2012">{{cite book| vauthors  = Fritz MA, Speroff L |title=Clinical Gynecologic Endocrinology and Infertility|url=https://books.google.com/books?id=KZLubBxJEwEC&pg=PA751|date=28 March 2012|publisher=Lippincott Williams & Wilkins|isbn=978-1-4511-4847-3|pages=751–}}</ref><ref name="HumansOrganization2007">{{cite book|author1=IARC Working Group on the Evaluation of Carcinogenic Risks to Humans|author2=World Health Organization|author3=International Agency for Research on Cancer|title=Combined Estrogen-progestogen Contraceptives and Combined Estrogen-progestogen Menopausal Therapy|url=https://books.google.com/books?id=aGDU5xibtNgC&pg=PA378|year=2007|publisher=World Health Organization|isbn=978-92-832-1291-1|pages=378–}}</ref> The compound, as the 3-[[sulfate]] [[ester]] [[sodium]] [[salt (chemistry)|salt]], is present in [[conjugated estrogens]] (Premarin), a [[pharmaceutical drug|pharmaceutical]] [[extract]] of the [[urine]] of [[pregnancy|pregnant]] [[mare]]s, and is the third highest quantity constituent in the formulation (13.8%).<ref name="FritzSperoff2012" /> The compound has been studied clinically.<ref name="WilcoxStanczyk1996">{{cite journal | vauthors = Wilcox JG, Stanczyk FZ, Morris RS, Gentzschein E, Lobo RA | title = Biologic effects of 17 alpha-dihydroequilin sulfate | journal = Fertility and Sterility | volume = 66 | issue = 5 | pages = 748–52 | date = November 1996 | pmid = 8893678 | doi = 10.1016/S0015-0282(16)58629-4 | doi-access = free }}</ref>

== See also ==
* [[List of estrogens#Equine estrogens|List of estrogens § Equine estrogens]]

== References ==
{{Reflist}}

{{Estrogens and antiestrogens}}
{{Estrogen receptor modulators}}

{{DEFAULTSORT:Dihydroequilin, 17α-}}

[[Category:Secondary alcohols]]
[[Category:Estranes]]
[[Category:Estrogens]]

{{Genito-urinary-drug-stub}}
{{Steroid-stub}}