2-Methoxyestriolのソースを表示

{{distinguish|2-Methoxyestradiol}}
{{Chembox
<!-- Images -->
| ImageFile = 2-methoxyestriol.svg
| ImageSize = 200px
| ImageAlt = 
<!-- Names -->
| IUPACName = 2-Methoxyestra-1,3,5(10)-triene-3,16α,17β-triol
| SystematicName = (1''R'',2''R'',3a''S'',3b''R'',9b''S'',11a''S'')-8-Methoxy-11a-methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1''H''-cyclopenta[''a'']phenanthrene-1,2,7-triol
| OtherNames = 2-MeO-E3
<!-- Sections -->
| Section1 = {{Chembox Identifiers
| CASNo = 1236-72-2
| ChEMBL = 1908077
| ChemSpiderID = 92169
| InChI = 1S/C19H26O4/c1-19-6-5-11-12(14(19)9-16(21)18(19)22)4-3-10-7-15(20)17(23-2)8-13(10)11/h7-8,11-12,14,16,18,20-22H,3-6,9H2,1-2H3/t11-,12+,14-,16+,18-,19-/m0/s1
| InChIKey = PEXPJFWTSZLEAQ-YSYMNNNUSA-N
| PubChem = 102031
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)O)CCC4=CC(=C(C=C34)OC)O
  }}
| Section2 = {{Chembox Properties
| C=19 | H=26 | O=4
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
| Section3 = {{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
  }}
}}

'''2-Methoxyestriol''' ('''2-MeO-E3''') is an [[endogenous]] [[estrogen]] [[metabolite]].<ref name="pmid13584013">{{cite journal | vauthors = Fishman J, Gallagher TF | title = 2-Methoxyestriol: a new metabolite of estradiol in man | journal = Arch. Biochem. Biophys. | volume = 77 | issue = 2 | pages = 511–3 | date = October 1958 | pmid = 13584013 | doi = 10.1016/0003-9861(58)90097-3 }}</ref><ref name="pmid13756104">{{cite journal | vauthors = King RJ | title = Oestriol metabolism by rat- and rabbit-liver slices. Isolation of 2-methoxyoestriol and 2-hydroxyestriol | journal = Biochem. J. | volume = 79 | issue = 2| pages = 355–61 | date = May 1961 | pmid = 13756104 | pmc = 1205847 | doi = 10.1042/bj0790355 }}</ref><ref name="pmid3198067">{{cite journal | vauthors = Fujii Y, Teranishi M, Nakada K, Yamazaki M, Kishida S, Miyabo S | title = Radioimmunoassay of 2-methoxyestriol in pregnancy plasma | journal = Horm. Metab. Res. | volume = 20 | issue = 9 | pages = 599–600 | date = September 1988 | pmid = 3198067 | doi = 10.1055/s-2007-1010895 | s2cid = 260170130 }}</ref> It is specifically a metabolite of [[estriol]] and [[2-hydroxyestriol]].<ref name="pmid13584013" /><ref name="pmid13756104" /><ref name="pmid3198067" /> It has negligible [[affinity (pharmacology)|affinity]] for the [[estrogen receptor]]s and no [[estrogen (medication)|estrogen]]ic activity.<ref name="pmid6310247">{{cite journal | vauthors = Martucci CP | title = The role of 2-methoxyestrone in estrogen action | journal = J. Steroid Biochem. | volume = 19 | issue = 1B | pages = 635–8 | date = July 1983 | pmid = 6310247 | doi = 10.1016/0022-4731(83)90229-7 }}</ref> However, 2-methoxyestriol does have some non-[[estrogen receptor]]-mediated [[lipid-lowering agent|cholesterol-lowering]] effects.<ref name="KonoHiga1989">{{cite journal |last1=Kono |first1=Shinzo |last2=Higa |first2=Hiroaki |last3=Sunagawa |first3=Hajime |title=Hypocholesterolemic Effect of Long-Term Continuous Administration of 2-Methoxyestriol in Dietary Hypercholesterolemic Rats|journal=Journal of Clinical Biochemistry and Nutrition |volume=6 |issue=1 |year=1989 |pages=49–56 |issn=1880-5086 |doi=10.3164/jcbn.6.49 |doi-access=free}}</ref>

{{Selected biological properties of endogenous estrogens in rats}}

==See also==
* [[2-Methoxyestradiol]]
* [[2-Methoxyestrone]]
* [[4-Methoxyestradiol]]
* [[4-Methoxyestrone]]

==References==
{{Reflist}}

{{Endogenous steroids}}
{{Estrogen receptor modulators}}

{{DEFAULTSORT:Methoxyestriol, 2-}}
[[Category:Estranes]]
[[Category:Ethers]]
[[Category:Hypolipidemic agents]]
[[Category:Human metabolites]]
[[Category:Hydroxyarenes]]
[[Category:Sterols]]


{{Steroid-stub}}