3α-Hydroxytiboloneのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = (3''R'',7''R'',8''R'',9''S'',13''S'',14''S'',17''R'')-17-Ethynyl-7,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1''H''-cyclopenta[''a'']phenanthrene-3,17-diol
| image = 3α-Hydroxytibolone.svg
| width = 225px

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = 
| class = 

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 

<!-- Identifiers -->
| CAS_number_Ref = 
| CAS_number = 100239-44-9
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 10087021
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 8262558
| UNII = 37T303O94A
| KEGG = 
| ChEBI = 
| ChEMBL = 
| synonyms = ORG-4094; 7α-Methyl-17α-ethynylestr-5(10)-ene-3α,17β-diol

<!--Chemical data-->
| C=21 | H=30 | O=2
| SMILES = C[C@@H]1CC2=C(CC[C@H](C2)O)[C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(C#C)O
| StdInChI_Ref = 
| StdInChI = 1S/C21H30O2/c1-4-21(23)10-8-18-19-13(2)11-14-12-15(22)5-6-16(14)17(19)7-9-20(18,21)3/h1,13,15,17-19,22-23H,5-12H2,2-3H3/t13-,15-,17-,18+,19-,20+,21+/m1/s1
| StdInChIKey_Ref = 
| StdInChIKey = YLEUWNOTNJZCBN-CZTKNSHGSA-N
}}

'''3α-Hydroxytibolone''' (developmental code name '''ORG-4094''') is a [[synthetic compound|synthetic]] [[steroid]]al [[estrogen (medication)|estrogen]] which was never marketed.<ref name="Kuhl2005">{{cite journal|last1=Kuhl|first1=H|title=Pharmacology of estrogens and progestogens: influence of different routes of administration|journal=Climacteric|volume=8|issue=sup1|year=2005|pages=3–63|issn=1369-7137|doi=10.1080/13697130500148875|pmid=16112947|s2cid=24616324}}</ref><ref name="pmid19464167">{{cite journal | vauthors = Escande A, Servant N, Rabenoelina F, Auzou G, Kloosterboer H, Cavaillès V, Balaguer P, Maudelonde T | title = Regulation of activities of steroid hormone receptors by tibolone and its primary metabolites | journal = J. Steroid Biochem. Mol. Biol. | volume = 116 | issue = 1–2 | pages = 8–14 | year = 2009 | pmid = 19464167 | doi = 10.1016/j.jsbmb.2009.03.008 | s2cid = 18346113 | url = http://www.hal.inserm.fr/inserm-00396319/document}}</ref> Along with [[3β-hydroxytibolone]] and [[δ4-tibolone|δ<sup>4</sup>-tibolone]], it is a major [[active metabolite]] of [[tibolone]], and 3α-hydroxytibolone and 3β-hydroxytibolone are thought to be responsible for the [[estrogen (medication)|estrogen]]ic activity of tibolone.<ref name="Kuhl2005" /><ref name="pmid19464167" />

==References==
{{Reflist}}


{{Estrogen receptor modulators}}

{{DEFAULTSORT:Hydroxytibolone, 3α-}}

[[Category:Abandoned drugs]]
[[Category:Alkene derivatives]]
[[Category:Ethynyl compounds]]
[[Category:Diols]]
[[Category:Estranes]]
[[Category:Human drug metabolites]]
[[Category:Synthetic estrogens]]
[[Category:Secondary alcohols]]
[[Category:Tertiary alcohols]]


{{Genito-urinary-drug-stub}}
{{Steroid-stub}}