Levormeloxifeneのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields =
| verifiedrevid = 462091315
| IUPAC_name = 1-(2-[4-[(3''R'',4''R'')-7-Methoxy-2,2-dimethyl-3-phenyl-3,4-dihydro-2''H''-chromen-4-yl]phenoxy]ethyl)pyrrolidine
| image = Levormeloxifene.svg
| width = 225px

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 78994-23-7
| CAS_supplemental =
| class =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 35805
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 32935
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9512UKZ352
| KEGG =
| ChEBI =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 301327
| synonyms = Levomeloxifene; 6720-CDRI; NNC-460020

<!--Chemical data-->
| C=30 | H=35 | N=1 | O=3
| SMILES = O(c1ccc(cc1)[C@@H]3c4c(OC([C@H]3c2ccccc2)(C)C)cc(OC)cc4)CCN5CCCC5
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C30H35NO3/c1-30(2)29(23-9-5-4-6-10-23)28(26-16-15-25(32-3)21-27(26)34-30)22-11-13-24(14-12-22)33-20-19-31-17-7-8-18-31/h4-6,9-16,21,28-29H,7-8,17-20H2,1-3H3/t28-,29+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XZEUAXYWNKYKPL-WDYNHAJCSA-N
}}

'''Levormeloxifene''' ({{abbrlink|INN|International Nonproprietary Name}}; developmental code names '''6720-CDRI''', '''NNC-460020''') is a [[selective estrogen receptor modulator]] (SERM) which was being developed as an alternative to [[hormone replacement therapy (menopause)|estrogen replacement therapy]] for the treatment and prevention of [[menopause|postmenopausal]] [[Osteoporosis|bone loss]] but did not complete development and hence was never marketed.<ref name="AdisInsight">{{Cite web | url=http://adisinsight.springer.com/drugs/800000737 |title = Levormeloxifene - AdisInsight}}</ref> The development was stopped because of a high incidence of [[gynecological]] [[side effect]]s during [[clinical trial]]s.<ref name="pmid16532904">{{cite journal | vauthors = Ravn P, Nielsen TF, Christiansen C | title = What can be learned from the levormeloxifene experience? | journal = Acta Obstet Gynecol Scand | volume = 85 | issue = 2 | pages = 135–42 | year = 2006 | pmid = 16532904 | doi = 10.1080/00016340500345691| s2cid = 12872469 | doi-access = free }}</ref> Levormeloxifene is the [[dextrorotation and levorotation|levorotatory]] [[enantiomer]] of [[ormeloxifene]], which, in contrast, has been marketed, though rather as a [[hormonal contraceptive]].

==See also==
* [[List of selective estrogen receptor modulators]]

==References==
{{Reflist|2}}

==External links==
* [http://adisinsight.springer.com/drugs/800000737 Levormeloxifene - AdisInsight]

{{Estrogen receptor modulators}}

[[Category:Abandoned drugs]]
[[Category:Benzopyrans]]
[[Category:Ethers]]
[[Category:1-Pyrrolidinyl compounds]]
[[Category:Selective estrogen receptor modulators]]


{{genito-urinary-drug-stub}}