Taleranolのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = (7''S'',11''S'')-7,15,17-Trihydroxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),15,17-trien-13-one
| image = Taleranol.svg
| width = 250

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = 

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = 
| CAS_number = 42422-68-4
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 65434
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 
| UNII = HUN219N434
| KEGG = 
| ChEBI = 35071
| ChEMBL = 491510

<!--Chemical data-->
| C=18 | H=26 | O=5
| SMILES = C[C@H]1CCC[C@@H](O)CCCCCc2cc(O)cc(O)c2C(=O)O1
| StdInChI_Ref = 
| StdInChI = 1S/C18H26O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,14,19-21H,2-9H2,1H3/t12-,14-/m0/s1
| StdInChIKey_Ref = 
| StdInChIKey = DWTTZBARDOXEAM-JSGCOSHPSA-N
| synonyms = P-1560; Teranol; β-Zearalanol
}}

'''Taleranol''' ([[International Nonproprietary Name|INN]], [[United States Adopted Name|USAN]]) (developmental code name '''P-1560'''), or '''teranol''', also known as '''β-zearalanol''', is a [[synthetic compound|synthetic]], [[nonsteroidal]] [[estrogen]] of the [[resorcylic acid lactone]] group related to [[mycoestrogen]]s found in ''[[Fusarium|Fusarium spp]]'' which was never marketed.<ref name="Elks2014">{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA350|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=350–}}</ref><ref name="Yildiz2009">{{cite book| vauthors = Yildiz F |title=Advances in Food Biochemistry|url=https://books.google.com/books?id=orwY4Nd_t1wC&pg=PA233|date=16 December 2009|publisher=CRC Press|isbn=978-1-4200-0769-5|pages=233–}}</ref> It is the β [[epimer]] of [[zeranol]] (α-zearalanol) and is a major [[metabolite]] of zeranol but with less [[biological activity]].<ref name="Elks2014" /><ref name="YuWang2014">{{cite book| vauthors = Yu L, Wang S, Sun BG |title=Food Safety Chemistry: Toxicant Occurrence, Analysis and Mitigation|url=https://books.google.com/books?id=rs3MBQAAQBAJ&pg=PA240|date=28 October 2014|publisher=CRC Press|isbn=978-1-4665-9795-2|pages=240–}}</ref><ref name="Yildiz2009" />

==See also==
* [[α-Zearalenol]]
* [[β-Zearalenol]]
* [[Zearalanone]]
* [[Zearalenone]]

==References==
{{Reflist}}


{{Xenoestrogens}}
{{Estrogen receptor modulators}}

[[Category:Lactones]]
[[Category:Mycoestrogens]]
[[Category:Mycotoxins]]
[[Category:Resorcinols]]


{{genito-urinary-drug-stub}}