4-Hydroxyestradiolのソースを表示

{{Chembox
<!-- Images -->
| ImageFile = 4-Hydroxyestradiol.svg
| ImageSize = 200px
| ImageAlt =
<!-- Names -->
| IUPACName = Estra-1,3,5(10)-triene-3,4,17β-triol
| SystematicName = (1''S'',3a''S'',3b''R'',9b''S'',11a''S'')-11a-Methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1''H''-cyclopenta[''a'']phenanthrene-1,6,7-triol
| OtherNames = 4-OHE2; 3,4,17β-Trihydroxyestra-1,3,5(10)-triene
<!-- Sections -->
| Section1 = {{Chembox Identifiers
| CASNo = 5976-61-4
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII = C3ZO03450E
| UNII_Ref = {{fdacite|correct|FDA}}
| ChEBI = 62845
| ChEMBL = 1412489
| ChemSpiderID = 4445523
| KEGG = C14209
| PubChem = 5282360
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4O)O
| StdInChI = 1S/C18H24O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,16,19-21H,2-3,5,7-9H2,1H3/t11-,12-,14+,16+,18+/m1/s1
| StdInChIKey = QOZFCKXEVSGWGS-ZHIYBZGJSA-N
  }}
| Section2 = {{Chembox Properties
| C=18 | H=24 | O=3
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
  }}
}}

'''4-Hydroxyestradiol''' ('''4-OHE2'''), also known as '''estra-1,3,5(10)-triene-3,4,17β-triol''', is an [[endogenous]], [[natural product|naturally occurring]] [[catechol estrogen]] and a minor [[metabolite]] of [[estradiol]].<ref name="OettelSchillinger2012">{{cite book|author1=Michael Oettel|author2=Ekkehard Schillinger|title=Estrogens and Antiestrogens I: Physiology and Mechanisms of Action of Estrogens and Antiestrogens|url=https://books.google.com/books?id=0BfrCAAAQBAJ&pg=PA232|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-3-642-58616-3|pages=224, 232, 244–245, 249}}</ref> It is [[estrogen]]ic, similarly to many other hydroxylated estrogen metabolites such as [[2-hydroxyestradiol]], [[16α-hydroxyestrone]], [[estriol]] (16α-hydroxyestradiol), and [[4-hydroxyestrone]] but unlike [[2-hydroxyestrone]].<ref name="OettelSchillinger2012" /><ref name="pmid10865186">{{cite journal | vauthors = Bhavnani BR, Nisker JA, Martin J, Aletebi F, Watson L, Milne JK | title = Comparison of pharmacokinetics of a conjugated equine estrogen preparation (premarin) and a synthetic mixture of estrogens (C.E.S.) in postmenopausal women | journal = J. Soc. Gynecol. Investig. | volume = 7 | issue = 3 | pages = 175–83 | year = 2000 | pmid = 10865186 | doi = 10.1016/s1071-5576(00)00049-6}}</ref>

{{Selected biological properties of endogenous estrogens in rats}}

==See also==
* [[Estrogen conjugate]]
* [[Lipoidal estradiol]]

==References==
{{Reflist}}

==External links==
* [http://www.hmdb.ca/metabolites/HMDB05896 Metabocard for 4-Hydroxyestradiol - Human Metabolome Database]


{{Endogenous steroids}}
{{Estrogen receptor modulators}}

{{DEFAULTSORT:Hydroxyestradiol, 4-}}

[[Category:Sterols]]
[[Category:Hydroxyarenes]]
[[Category:Cyclopentanols]]
[[Category:Estranes]]
[[Category:Estrogens]]
[[Category:Human metabolites]]


{{steroid-stub}}
{{biochemistry-stub}}