17β-Dihydroequileninのソースを表示

{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc}}
{{Distinguish|17α-Dihydroequilin|17β-Dihydroequilin|17α-Dihydroequilenin}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = (13''S'',14''S'',17''S'')-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[''a'']phenanthrene-3,17-diol
| image = 17β-Dihydroequilenin.svg
| width = 225px

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = [[Oral administration|By mouth]]
| class = [[Estrogen (medication)|Estrogen]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 1423-97-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ET2MK3VGB4
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 3032407
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 2297390 
| KEGG = 
| ChEBI = 
| ChEMBL = 123405
| synonyms = β-Dihydroequilenin; Δ<sup>6,8</sup>-17β-Estradiol; 6,8-Didehydro-17β-estradiol; Estra-1,3,5(10),6,8-pentaen-3,17β-diol

<!--Chemical data-->
| C=18 | H=20 | O=2
| SMILES = C[C@]12CCC3=C([C@@H]1CC[C@@H]2O)C=CC4=C3C=CC(=C4)O
| StdInChI_Ref = 
| StdInChI = 1S/C18H20O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h2-5,10,16-17,19-20H,6-9H2,1H3/t16-,17-,18-/m0/s1
| StdInChIKey_Ref = 
| StdInChIKey = RYWZPRVUQHMJFF-BZSNNMDCSA-N
}}

'''17β-Dihydroequilenin''', or '''β-dihydroequilenin''', also known as '''δ<sup>6,8</sup>-17β-estradiol''' or '''6,8-didehydro-17β-estradiol''', as well as '''estra-1,3,5(10),6,8-pentaen-3,17β-diol''', is a [[naturally occurring]] [[steroid]]al [[estrogen (medication)|estrogen]] found in [[equine|horse]]s which is closely related to [[equilin]], [[equilenin]], and [[estradiol (medication)|estradiol]], and, as the 3-[[sulfate]] [[ester]] [[sodium]] [[salt (chemistry)|salt]], is a minor constituent (0.5%) of [[conjugated estrogens]] (Premarin).<ref name="FritzSperoff2012">{{cite book| vauthors = Fritz MA, Speroff L | chapter = Postmenopausal Hormone Therapy |title=Clinical Gynecologic Endocrinology and Infertility |chapter-url=https://books.google.com/books?id=KZLubBxJEwEC&pg=PA751|date=28 March 2012|publisher=Lippincott Williams & Wilkins|isbn=978-1-4511-4847-3|pages=751–}}</ref> 17β-Dihydroequilenin has unexpectedly shown a [[selective estrogen receptor modulator]] (SERM)-like profile of estrogenic activity in studies with monkeys, in which beneficial effects on [[bone]] and the [[cardiovascular]] system were noted but [[cell proliferation|proliferative]] responses in [[breast]] and [[endometrium]] were not observed.<ref name="pmid17443713">{{cite journal | vauthors = Cline JM | title = Assessing the mammary gland of nonhuman primates: effects of endogenous hormones and exogenous hormonal agents and growth factors | journal = Birth Defects Research. Part B, Developmental and Reproductive Toxicology | volume = 80 | issue = 2 | pages = 126–146 | date = April 2007 | pmid = 17443713 | doi = 10.1002/bdrb.20112 }}</ref>

== See also ==
* {{slink|List of estrogens|Equine estrogens}}

== References ==
{{Reflist}}

{{Estrogens and antiestrogens}}
{{Estrogen receptor modulators}}

{{DEFAULTSORT:Dihydroequilenin, 17β-}}

[[Category:Secondary alcohols]]
[[Category:Estranes]]
[[Category:Estrogens]]


{{Steroid-stub}}
{{Genito-urinary-drug-stub}}