4-Methoxyestradiolのソースを表示

{{Chembox
<!-- Images -->
| ImageFile = 4-Methoxyestradiol.svg
| ImageSize = 200px
| ImageAlt =
<!-- Names -->
| IUPACName = 4-Methoxyestra-1,3,5(10)-triene-3,17β-diol
| SystematicName = (1''S'',3a''S'',3b''R'',9b''S'',11a''S'')-6-Methoxy-11a-methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1''H''-cyclopenta[''a'']phenanthrene-1,7-diol
| OtherNames = 4-ME2; 4-MeOE2; 4-MeO-E2; 4-Methoxy-17β-estradiol; Estra-1,3,5(10)-trien-3,4,17β-triol 4-methyl ether
<!-- Sections -->
| Section1 = {{Chembox Identifiers
| CASNo = 26788-23-8
| ChemSpiderID = 61848
| ChEBI = 136975
| PubChem = 68578
| StdInChI = 1S/C19H26O3/c1-19-10-9-12-11-5-7-16(20)18(22-2)14(11)4-3-13(12)15(19)6-8-17(19)21/h5,7,12-13,15,17,20-21H,3-4,6,8-10H2,1-2H3/t12-,13-,15+,17+,19+/m1/s1
| StdInChIKey = BCWZIZLVBYHFES-PYEWSWHRSA-N
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4OC)O
  }}
| Section2 = {{Chembox Properties
| C=19 | H=26 | O=3
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
  }}
}}

'''4-Methoxyestradiol''' ('''4-ME2''') is an [[endogenous]], [[natural product|naturally occurring]] [[methoxyl]]ated [[catechol estrogen]] and [[metabolite]] of [[estradiol]] that is formed by [[catechol O-methyltransferase]] via the [[chemical intermediate|intermediate]] [[4-hydroxyestradiol]].<ref name="HMDB">{{Cite web|url=http://www.hmdb.ca/metabolites/HMDB12782|title = Human Metabolome Database: Showing metabocard for 4-Methoxy-17beta-estradiol (HMDB0012782)}}</ref><ref name="Hemnes2015">{{cite book|author=Anna R. Hemnes|title=Gender, Sex Hormones and Respiratory Disease: A Comprehensive Guide|url=https://books.google.com/books?id=4So3CwAAQBAJ&pg=PA32|date=16 December 2015|publisher=Humana Press|isbn=978-3-319-23998-9|pages=32–}}</ref><ref name="LauritzenStudd2005">{{cite book|author1=Christian Lauritzen|author2=John W. W. Studd|title=Current Management of the Menopause|url=https://books.google.com/books?id=WD7S7677xUUC&pg=PA378|date=22 June 2005|publisher=CRC Press|isbn=978-0-203-48612-2|pages=378–379}}</ref> It has [[estrogen]]ic activity similarly to [[estrone]] and [[4-hydroxyestrone]].<ref name="pmid10865186">{{cite journal | vauthors = Bhavnani BR, Nisker JA, Martin J, Aletebi F, Watson L, Milne JK | title = Comparison of pharmacokinetics of a conjugated equine estrogen preparation (premarin) and a synthetic mixture of estrogens (C.E.S.) in postmenopausal women | journal = J. Soc. Gynecol. Investig. | volume = 7 | issue = 3 | pages = 175–83 | year = 2000 | pmid = 10865186 | doi = 10.1016/s1071-5576(00)00049-6}}</ref>

{{Selected biological properties of endogenous estrogens in rats}}

==See also==
* [[2-Methoxyestradiol]]
* [[2-Methoxyestriol]]
* [[2-Methoxyestrone]]
* [[4-Methoxyestrone]]

==References==
{{Reflist}}

==External links==
* [http://www.hmdb.ca/metabolites/HMDB12782 Metabocard for 4-Methoxyestradiol - Human Metabolome Database]


{{Endogenous steroids}}
{{Estrogen receptor modulators}}

{{DEFAULTSORT:Methoxyestradiol, 4-}}

[[Category:Secondary alcohols]]
[[Category:Estranes]]
[[Category:Estrogens]]
[[Category:Ethers]]
[[Category:Human metabolites]]
[[Category:Steroid hormones]]


{{steroid-stub}}