4-Methoxyestriolのソースを表示

{{Chembox
<!-- Images -->
| ImageFile = 4-methoxyestriol.svg
| ImageSize = 200px
| ImageAlt = 
<!-- Names -->
| IUPACName = 4-Methoxyestra-1,3,5(10)-triene-3,16α,17β-triol
| SystematicName = (1''R'',2''R'',3a''S'',3b''R'',9b''S'',11a''S'')-6-Methoxy-11a-methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1''H''-cyclopenta[''a'']phenanthrene-1,2,7-triol
| OtherNames = 4-MeO-E3
<!-- Sections -->
| Section1 = {{Chembox Identifiers
| CASNo = 101534-28-5
| ChemSpiderID = 8077213
| InChI = 1S/C19H26O4/c1-19-8-7-11-10-5-6-15(20)17(23-2)13(10)4-3-12(11)14(19)9-16(21)18(19)22/h5-6,11-12,14,16,18,20-22H,3-4,7-9H2,1-2H3/t11-,12-,14+,16-,18+,19+/m1/s1
| InChIKey = MTZUPVFOGAXGJG-JUVWIQMMSA-N
| PubChem = 9901559
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)O)CCC4=C3C=CC(=C4OC)O
  }}
| Section2 = {{Chembox Properties
| C=19 | H=26 | O=4
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
| Section3 = {{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
  }}
}}

'''4-Methoxyestriol''' ('''4-MeO-E3''') is an [[endogenous]] [[estrogen]] [[metabolite]].<ref name="pmid2706375">{{cite journal | vauthors = Gerhardt K, Ludwig-Köhn H, Henning HV, Remberg G, Zeeck A | title = Identification of oestrogen metabolites in human urine by capillary gas chromatography and mass spectrometry | journal = Biomed. Environ. Mass Spectrom. | volume = 18 | issue = 2 | pages = 87–95 | date = February 1989 | pmid = 2706375 | doi = 10.1002/bms.1200180202 }}</ref><ref name="pmid23597399">{{cite journal | vauthors = Gaikwad NW | title = Ultra performance liquid chromatography-tandem mass spectrometry method for profiling of steroid metabolome in human tissue | journal = Anal. Chem. | volume = 85 | issue = 10 | pages = 4951–60 | date = May 2013 | pmid = 23597399 | doi = 10.1021/ac400016e }}</ref><ref name="pmid1606638">{{cite journal | vauthors = Fujii Y, Teranishi M, Nakada K, Yamazaki M, Kishida S, Miyabo S | title = Radioimmunoassay for the determination of 2-methoxyestriol concentration in plasma of pregnant women | journal = Chem. Pharm. Bull. | volume = 40 | issue = 2 | pages = 410–3 | date = February 1992 | pmid = 1606638 | doi = 10.1248/cpb.40.410 | doi-access = free }}</ref><ref name="pmid16728493">{{cite journal | vauthors = Zhu BT, Han GZ, Shim JY, Wen Y, Jiang XR | title = Quantitative structure-activity relationship of various endogenous estrogen metabolites for human estrogen receptor alpha and beta subtypes: Insights into the structural determinants favoring a differential subtype binding | journal = Endocrinology | volume = 147 | issue = 9 | pages = 4132–50 | date = September 2006 | pmid = 16728493 | doi = 10.1210/en.2006-0113 | doi-access =  }}</ref> It is the 4-[[methyl group|methyl]] [[ether]] of [[4-hydroxyestriol]] and a metabolite of [[estriol]] and 4-hydroxyestriol.<ref name="pmid2706375" /><ref name="pmid23597399" /><ref name="pmid1606638" /> 4-Methoxyestriol has very low [[affinity (pharmacology)|affinities]] for the [[estrogen receptor]]s.<ref name="pmid16728493" /> Its [[relative binding affinity|relative binding affinities]] (RBAs) for [[estrogen receptor alpha]] (ERα) and [[estrogen receptor beta]] (ERβ) are both about 1% of those of [[estradiol]].<ref name="pmid16728493" /> For comparison, estriol had RBAs of 11% and 35%, respectively.<ref name="pmid16728493" />

==See also==
* [[2-Methoxyestradiol]]
* [[2-Methoxyestriol]]
* [[2-Methoxyestrone]]
* [[4-Methoxyestradiol]]
* [[4-Methoxyestrone]]

==References==
{{Reflist}}

{{Endogenous steroids}}

{{DEFAULTSORT:Methoxyestradiol, 4-}}
[[Category:Estranes]]
[[Category:Ethers]]
[[Category:Human metabolites]]
[[Category:Hydroxyarenes]]


{{Steroid-stub}}