Β-Sitosterolのソースを表示

{{lowercase title}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 396299902
| Name =β-Sitosterol
| ImageFile = Sitosterol structure.svg
| ImageSize = 240
| ImageAlt = Skeletal formula of sitosterol
| ImageFile1 = Sitosterol-3D-balls.png
| ImageSize1 = 250
| ImageAlt1 = Ball-and-stick model of the sitosterol molecule
| IUPACName = Stigmast-5-en-3β-ol
| SystematicName = (1''R'',3a''S'',3b''S'',7''S'',9a''R'',9b''S'',11a''R'')-1-[(2''R'',5''R'')-5-Ethyl-6-methylheptan-2-yl]-9a,11a-dimethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1''H''-cyclopenta[''a'']phenanthren-7-ol
| OtherNames = 22,23-Dihydrostigmasterol, β-Sitosterin
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 192962
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = S347WMO6M4
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 221542
| InChI = 1/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1
| InChIKey = KZJWDPNRJALLNS-VJSFXXLFBZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KZJWDPNRJALLNS-VJSFXXLFSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 83-46-5
| PubChem = 222284
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 27693
| SMILES = O[C@@H]4C/C3=C/C[C@@H]1[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CC[C@@H](CC)C(C)C)C)[C@@]3(C)CC4
| MeSHName =
  }}
|Section2={{Chembox Properties
| C=29 | H=50 | O=1
| Appearance =
| Density =
| MeltingPtC = 136 to 140
| MeltingPt_ref = <ref>{{Cite journal |last=Oja |first=Vahur |last2=Chen |first2=Xu |last3=Hajaligol |first3=Mohammad R. |last4=Chan |first4=W. Geoffrey |year=2009 |title=Sublimation Thermodynamic Parameters for Cholesterol, Ergosterol, β-Sitosterol, and Stigmasterol |journal=Journal of Chemical & Engineering Data |volume=54 |issue=3 |pages=730–734 |doi=10.1021/je800395m}}</ref>
| BoilingPt =
  }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
 }}
}}

'''β-Sitosterol''' (''beta''-sitosterol) is one of several [[phytosterol]]s (plant sterols) with [[chemical structure]]s similar to that of [[cholesterol]]. It is a white, waxy powder with a characteristic odor, and is one of the components of the [[food additive]] [[E499]]. Phytosterols are hydrophobic and soluble in alcohols.