Arzoxifeneのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 457819279
| IUPAC_name = 2-(4-Methoxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenoxy]-1-benzothiophen-6-ol
| image = Arzoxifene.svg
| width = 250px

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = [[Oral administration|By mouth]]
| class = [[Selective estrogen receptor modulator]]

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 182133-25-1
| CAS_supplemental = <br />182133-27-3 ([[hydrochloride]])
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 179337
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 156104
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = E569WG6E60
| KEGG = D02993
| ChEBI =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 226267
| synonyms = LY-353381

<!--Chemical data-->
| C=28 | H=29 | N=1 | O=4 | S=1
| SMILES = COC1=CC=C(C=C1)C2=C(C3=C(S2)C=C(C=C3)O)OC4=CC=C(C=C4)OCCN5CCCCC5
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C28H29NO4S/c1-31-22-8-5-20(6-9-22)28-27(25-14-7-21(30)19-26(25)34-28)33-24-12-10-23(11-13-24)32-18-17-29-15-3-2-4-16-29/h5-14,19,30H,2-4,15-18H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MCGDSOGUHLTADD-UHFFFAOYSA-N
}}

'''Arzoxifene''' ({{abbrlink|INN|International Nonproprietary Name}}; developmental code name '''LY-353381''') is a [[selective estrogen receptor modulator]] (SERM) of the [[benzothiophene]] group which was never marketed.<ref name="pmid17654759">{{cite journal |vauthors=Overk CR, Peng KW, Asghodom RT |title=Structure-activity relationships for a family of benzothiophene selective estrogen receptor modulators including raloxifene and arzoxifene |journal=ChemMedChem |volume=2 |issue=10 |pages=1520–6 |year=2007 |pmid=17654759 |doi=10.1002/cmdc.200700104|s2cid=35664796 |display-authors=etal}}</ref> It is a potent [[estrogen]] [[receptor antagonist|antagonist]] in mammary and uterine tissue while acting as an estrogen [[agonist]] to maintain bone density and lower serum cholesterol. Arzoxifene is a highly effective agent for prevention of mammary cancer induced in the rat by the [[carcinogen]] [[nitrosomethylurea]] and is significantly more potent than raloxifene in this regard. Arzoxifene is devoid of the uterotrophic effects of tamoxifen, suggesting that, in contrast to tamoxifen, it is unlikely that the clinical use of arzoxifene will increase the risk of developing endometrial carcinoma.