Benzestrolのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = 4,4'-(3-ethylhexane-2,4-diyl)diphenol
| image = Benzestrol.png
| width = 250px

<!--Clinical data-->
| tradename = Chemestrogen, Ocestrol, Octestrol, Octoestrol, Octofollin
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = 
| class = [[Nonsteroidal estrogen]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!--Identifiers-->
| CAS_number_Ref = 
| CAS_number = 85-95-0
| CAS_supplemental = 
| ChEBI = 135264
| ChEMBL = 2104644
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = A27512LR47
| ATC_prefix = 
| ATC_suffix = 
| PubChem = 6827
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 6566
| synonyms = 

<!--Chemical data-->
| C=20 | H=26 | O=2
| SMILES = CCC(C1=CC=C(C=C1)O)C(CC)C(C)C2=CC=C(C=C2)O
| StdInChI_Ref = 
| StdInChI = InChI=1S/C20H26O2/c1-4-19(14(3)15-6-10-17(21)11-7-15)20(5-2)16-8-12-18(22)13-9-16/h6-14,19-22H,4-5H2,1-3H3
| StdInChIKey_Ref = 
| StdInChIKey = DUTFBSAKKUNBAL-UHFFFAOYSA-N
}}

'''Benzestrol''' ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|BAN|British Approved Name}}) (brand names '''Chemestrogen''', '''Ocestrol''', '''Octestrol''', '''Octoestrol''', '''Octofollin''') is a [[synthetic compound|synthetic]] [[nonsteroidal estrogen]] of the [[stilbestrol]] group which was formerly used medically but has since been discontinued.<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA133|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=133–}}</ref><ref name="MortonHall2012">{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA47|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=47–}}</ref><ref>{{cite book | chapter = Benzestrol |title=Index Nominum 2000: International Drug Directory| chapter-url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA106|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=106–}}</ref> The stilbestrol estrogens, the best-known of which is [[diethylstilbestrol]] (DES) were used extensively in the mid-1900s and were finally banned by the FDA due to them causing tumors in the children of women who used them.<ref name="cdc">{{cite web | publisher = U.S. Centers for Disease Control and Prevention | title = DES History | url = https://www.cdc.gov/des/consumers/about/history.html | archive-url = https://web.archive.org/web/20190615144848/https://www.cdc.gov/des/consumers/about/history.html | archive-date = 15 June 2019 | access-date = 17 December 2012 }}</ref>