Equileninのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 461094560
| IUPAC_name = (13''S'',14''S'')-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11''H''-cyclopenta[''a'']phenanthren-17-one
| image = Equilenin.svg
| width = 225px

<!--Clinical data-->
| tradename = 
| pregnancy_category = 
| legal_status = 
| routes_of_administration = [[Oral administration|By mouth]]
| class = [[Estrogen (medication)|Estrogen]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 517-09-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W8FTJ17C4J
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 444865
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB03515
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 392668
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C14303
| ChEBI = 34739
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 225546
| synonyms = 6,8-Didehydroestrone; Estra-1,3,5(10),6,8-pentaen-3-ol-17-one

<!--Chemical data-->
| C=18 | H=18 | O=2 
| SMILES = O=C4[C@]3(CCc1c(ccc2c1ccc(O)c2)[C@@H]3CC4)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H18O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h2-5,10,16,19H,6-9H2,1H3/t16-,18-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PDRGHUMCVRDZLQ-WMZOPIPTSA-N
}}

'''Equilenin''', also known as '''6,8-didehydroestrone''', as well as '''estra-1,3,5(10),6,8-pentaen-3-ol-17-one''', is a [[natural product|naturally occurring]] [[steroid]]al [[estrogen (medication)|estrogen]] obtained from the [[urine]] of [[pregnancy|pregnant]] [[mares]].<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA298|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=494–}}</ref><ref name="FritzSperoff2012">{{cite book| vauthors = Fritz MA, Speroff L |title=Clinical Gynecologic Endocrinology and Infertility|url=https://books.google.com/books?id=KZLubBxJEwEC&pg=PA751|date=28 March 2012|publisher=Lippincott Williams & Wilkins|isbn=978-1-4511-4847-3|pages=751–}}</ref> It is used as one of the components in [[conjugated estrogens]] (brand name Premarin).<ref name="FritzSperoff2012" /> It was the first complex natural product to be fully synthesized, in work reported by 1940 by [[Werner Emmanuel Bachmann|Bachmann]] and [[Alfred L. Wilds|Wilds]].<ref name = TS>{{cite journal|title = The Total Synthesis of the Sex Hormone Equilenin and Its Stereoisomers | vauthors = Bachmann WE, Cole W, Wilds AL |author-link1 = Werner Emmanuel Bachmann |author-link3 = Alfred L. Wilds |journal = [[J. Am. Chem. Soc.]] |year = 1940|volume = 62|issue = 4|pages = 824–839|doi = 10.1021/ja01861a036}}</ref>