Equilinのソースを表示

{{Short description|Chemical compound}}
{{Distinguish|Equilenin}}
{{Drugbox
| Verifiedfields = verified
| Watchedfields = verified
| verifiedrevid = 461094587
| IUPAC_name = (9''S'',13''S'',14''S'')-3-hydroxy-13-methyl-9,11,12,14,15,16-hexahydro-6''H''-cyclopenta[''a'']phenanthren-17-one
| image = Equilin.svg
| width = 225px

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = [[Oral administration|By mouth]]
| class = [[Estrogen (medication)|Estrogen]]

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 474-86-2
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 223368
| IUPHAR_ligand =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB02187
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 193995
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 08O86EX0J4
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04041
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 42309
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 323533
| synonyms = Δ<sup>7</sup>-Estrone; 7-Dehydroestrone; Estra-1,3,5(10),7-tetraen-3-ol-17-one

<!--Chemical data-->
| C=18 | H=20 | O=2
| SMILES = O=C3CC[C@H]4C/2=C/Cc1c(ccc(O)c1)[C@H]\2CC[C@]34C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H20O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3-5,10,14,16,19H,2,6-9H2,1H3/t14-,16+,18+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WKRLQDKEXYKHJB-HFTRVMKXSA-N
}}

'''Equilin''' is a [[natural product|naturally occurring]] [[estrogen (medication)|estrogen]] [[sex hormone]] found in [[horse]]s as well as a [[medication]].<ref name="Elks2014">{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA298|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=495}}</ref><ref name="pmid16112947">{{cite journal | vauthors = Kuhl H | title = Pharmacology of estrogens and progestogens: influence of different routes of administration | journal = Climacteric | volume = 8 | pages = 3–63 | year = 2005 | issue = Suppl 1 | pmid = 16112947 | doi = 10.1080/13697130500148875 | s2cid = 24616324 | url = http://hormonebalance.org/images/documents/Kuhl%2005%20%20Pharm%20Estro%20Progest%20Climacteric_1313155660.pdf}}</ref><ref name="pmid24176763">{{cite journal | vauthors = Bhavnani BR, Stanczyk FZ | title = Pharmacology of conjugated equine estrogens: efficacy, safety and mechanism of action | journal = J. Steroid Biochem. Mol. Biol. | volume = 142 | pages = 16–29 | date = July 2014 | pmid = 24176763 | doi = 10.1016/j.jsbmb.2013.10.011 | s2cid = 1360563 }}</ref> It is one of the estrogens present in the estrogen [[combination drug]] preparations known as [[conjugated estrogens]] (CEEs; e.g. '''Premarin''') and [[esterified estrogens]] (EEs; e.g. '''Estratab''', '''Menest''').<ref name="pmid16112947" /><ref name="pmid24176763" /> CEEs is the most commonly used form of estrogen medications in [[hormone replacement therapy]] (HRT) for [[menopausal symptoms]] in the [[United States]].<ref name="pmid24176763" /> [[Estrone sulfate (medication)|Estrone sulfate]] is the major estrogen in CEEs (about 50%) while equilin sulfate is the second major estrogen in the formulation, present as about 25% of the total.<ref name="pmid16112947" /><ref name="pmid24176763" />