Estrone sulfateのソースを表示

{{cs1 config|name-list-style=vanc}}
{{About|estrone sulfate as a hormone|its use as a medication|Estrone sulfate (medication)}}
{{Use dmy dates|date=August 2018}}
{{Chembox
<!-- Images -->
| ImageFile = Estrone sulfate.svg
| ImageClass = skin-invert
| ImageSize = 250px
| ImageAlt = Skeletal formula of estrone sulfate
| ImageFile2 = Estrone sulfate 3D ball.png
| ImageSize2 = 250px
| ImageAlt2 = Space-filling model of the estrone sulfate molecule
<!-- Names -->
| IUPACName = 17-Oxoestra-1,3,5(10)-trien-3-yl hydrogen sulfate
| SystematicName = (3a''S'',3b''R'',9b''S'',11a''S'')-11a-Methyl-1-oxo-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1''H''-cyclopenta[''a'']phenanthren-7-yl hydrogen sulfate
| OtherNames = E1S; Oestrone sulfate; Estrone 3-sulfate; Estra-1,3,5(10)-trien-17-one 3-sulfate
<!-- Sections -->
| Section1 = {{Chembox Identifiers
| CASNo = 481-97-0
| CASNoOther = 438-67-5 (sodium salt)
| ChEBI = 17474
| ChEMBL = 494753
| ChemSpiderID = 2272513
| DrugBank = DB04574
| EC_number = 207-120-4
| InChI = 1S/C18H22O5S/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h3,5,10,14-16H,2,4,6-9H2,1H3,(H,20,21,22)/t14-,15-,16+,18+/m1/s1
| InChIKey = JKKFKPJIXZFSSB-CBZIJGRNSA-N
| KEGG = C02538
| PubChem = 3001028
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OS(=O)(=O)O
| UNII = QTL48N278K
  }}
| Section2 = {{Chembox Properties
| C=18 | H=22 | O=5 | S=1
| MolarMass = 350.429 g/mol
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
  }}
}}

'''Estrone sulfate''', also known as '''E1S''', '''E1SO4''' and '''estrone 3-sulfate''', is a [[natural product|natural]], [[endogenous]] [[steroid]] and an [[estrogen ester]] and [[estrogen conjugate|conjugate]].<ref name="pmid27960570">{{cite journal | vauthors = Rezvanpour A, Don-Wauchope AC | title = Clinical implications of estrone sulfate measurement in laboratory medicine | journal = Crit Rev Clin Lab Sci | volume = 54 | issue = 2 | pages = 73–86 | date = March 2017 | pmid = 27960570 | doi = 10.1080/10408363.2016.1252310 | s2cid = 1825531 }}</ref><ref name="Lobo2007">{{cite book| first = Rogerio A. | last = Lobo |title=Treatment of the Postmenopausal Woman: Basic and Clinical Aspects|url=https://books.google.com/books?id=gywV9hkcyOMC&pg=PA768|date=5 June 2007|publisher=Academic Press|isbn=978-0-08-055309-2|pages=768–}}</ref><ref name="pmid16112947">{{cite journal | vauthors = Kuhl H | title = Pharmacology of estrogens and progestogens: influence of different routes of administration | journal = Climacteric | volume = 8 | pages = 3–63 | year = 2005 | issue = Suppl 1 | pmid = 16112947 | doi = 10.1080/13697130500148875 | s2cid = 24616324 | url = http://hormonebalance.org/images/documents/Kuhl%2005%20%20Pharm%20Estro%20Progest%20Climacteric_1313155660.pdf}}</ref>

In addition to its role as a natural hormone, estrone sulfate is used as a [[medication]], for instance in [[menopausal hormone therapy]]; for information on estrone sulfate as a medication, see the [[estrone sulfate (medication)]] article.