Estrone sulfate (medication)のソースを表示

{{Short description|Chemical compound}}
{{Use dmy dates|date=August 2018}}
{{About|estrone sulfate as a medication|its role as a hormone|Estrone sulfate}}
{{Drugbox
| Verifiedfields = verified
| Watchedfields = verified
| verifiedrevid = 443736791
| IUPAC_name = [(8''R'',9''S'',13''S'',14''S'')-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6''H''-cyclopenta[''a'']phenanthren-3-yl] hydrogen sulfate
| image = Estrone sulfate.svg
| width = 250px
| image2 = Estrone sulfate 3D ball.png
| width2 = 250px

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = [[Oral administration|By mouth]], others<ref name="pmid16112947" /><ref name="Drugs@FDA" /><ref name="BruckerKing2015" />
| class = [[Estrogen (medication)|Estrogen]]; [[Estrogen ester]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 90%, to [[human serum albumin|albumin]], and not to {{abbrlink|SHBG|sex hormone-binding globulin}}<ref name="Buchsbaum2012">{{cite book| vauthors = Buchsbaum HJ |title=The Menopause|url=https://books.google.com/books?id=z0LuBwAAQBAJ&pg=PA64|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-1-4612-5525-3|pages=63–64}}</ref>
| metabolism = [[Desulfation]] (via {{abbrlink|STS|steroid sulfatase}})<ref name="FalconeHurd2013" />
| metabolites = • [[Estrone (medication)|Estrone]]<ref name="pmid16112947" /><br />• [[Estradiol (medication)|Estradiol]]<ref name="pmid16112947" />
| elimination_half-life = 12 hours<ref name="WeckerWatts2009">{{cite book | vauthors = Wecker L, Watts S, Faingold C, Dunaway G, Crespo L |title=Brody's Human Pharmacology |url=https://books.google.com/books?id=kfsrz_-OrMQC&pg=PA456 |date=1 April 2009 |publisher=Elsevier Health Sciences |isbn=978-0-323-07575-6 |pages=456–}}</ref>
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 481-97-0
| CAS_supplemental = <br />438-67-5 ([[sodium]])<br />7280-37-7 ([[piperazine]])
| ATC_prefix = 
| ATC_suffix = 
| PubChem = 3001028
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04574
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2272513
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QTL48N278K
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 494753
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17474
| IUPHAR_ligand = 4749
| synonyms = E1S; Oestrone sulfate; Estrone 3-sulfate; Estra-1,3,5(10)-trien-17-one 3-sulfate

<!--Chemical data-->
| C=18 | H=22 | O=5 | S=1
| SMILES = O=S(=O)(O)Oc1cc4c(cc1)[C@H]3CC[C@@]2(C(=O)CC[C@H]2[C@@H]3CC4)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H22O5S/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h3,5,10,14-16H,2,4,6-9H2,1H3,(H,20,21,22)/t14-,15-,16+,18+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JKKFKPJIXZFSSB-CBZIJGRNSA-N
}}

'''Estrone sulfate''' ('''E1S''') is an [[estrogen (medication)|estrogen]] medication and naturally occurring [[steroid hormone]].<ref name="pmid16112947">{{cite journal | vauthors = Kuhl H | title = Pharmacology of estrogens and progestogens: influence of different routes of administration | journal = Climacteric | volume = 8 | pages = 3–63 | date = August 2005 | issue = Suppl 1 | pmid = 16112947 | doi = 10.1080/13697130500148875 | s2cid = 24616324 }}</ref> It is used in [[menopausal hormone therapy]] among other indications.<ref name="pmid16112947" /><ref name="Drugs@FDA" /> As the [[sodium]] [[salt (chemistry)|salt]] (sodium estrone sulfate), it is the major estrogen component of [[conjugated estrogens]] (Premarin) and [[esterified estrogens]] (Estratab, Menest).<ref name="pmid16112947" /><ref name="BruckerKing2015">{{cite book| vauthors = Brucker MC, King TL |title=Pharmacology for Women's Health|url=https://books.google.com/books?id=AniUCgAAQBAJ&pg=PA361|date=8 September 2015|publisher=Jones & Bartlett Publishers|isbn=978-1-284-05748-5|pages=361–}}</ref> In addition, E1S is used on its own as the [[piperazine]] salt [[estropipate]] (piperazine estrone sulfate; Ogen).<ref name="pmid16112947" /><ref name="BruckerKing2015" /> The compound also occurs as a major and important [[metabolite]] of [[estradiol (medication)|estradiol]] and [[estrone (medication)|estrone]].<ref name="pmid16112947" /> E1S is most commonly taken [[oral administration|by mouth]], but in the form of Premarin can also be taken by [[parenteral]] routes such as [[transdermal administration|transdermal]], [[vaginal administration|vaginal]], and [[injection (medicine)|injection]].<ref name="pmid16112947" /><ref name="Drugs@FDA">{{cite web | title = Drugs@FDA: FDA Approved Drug Products | publisher = United States Food and Drug Administration | access-date = 19 February 2018 | url = http://www.accessdata.fda.gov/scripts/cder/daf/}}</ref>