Kaempferolのソースを表示

{{cs1 config|name-list-style=vanc}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 406555414
| Name = Kaempferol
| ImageFile = Kaempferol.svg
| ImageSize = 250px
| ImageAlt = Skeletal formula of kaempferol
| ImageFile1 = Kaempferol-3D-balls.png
| ImageAlt1 = Ball-and-stick model of the kaempferol molecule
| IUPACName = 3,4′,5,7-Tetrahydroxyflavone
| SystematicName = 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4''H''-1-benzopyran-4-one
| OtherNames = Kaempherol; Robigenin; Pelargidenolon; Rhamnolutein; Rhamnolutin; Populnetin; Trifolitin; Kempferol; Swartziol
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 520-18-3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 731P2LE49E
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4444395
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 150
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 28499
| DrugBank = DB01852
| EC_number = 208-287-6
| SMILES = O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12
| StdInChI = 1S/C15H10O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,16-18,20H
| StdInChIKey = IYRMWMYZSQPJKC-UHFFFAOYSA-N
| PubChem = 5280863
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C05903
  }}
|Section2={{Chembox Properties
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>6</sub>
| MolarMass = 286.23 g/mol
| MeltingPt = 276–278&nbsp;°C
| Density = 1.688 g/mL
  }}
}}
'''Kaempferol''' (3,4′,5,7-tetrahydroxyflavone) is a natural [[flavonol]], a type of [[flavonoid]], found in a variety of plants and plant-derived foods including [[kale]], [[bean]]s, [[tea]], [[spinach]], and [[broccoli]].<ref>{{Cite journal|last1=Holland|first1=Thomas M.|last2=Agarwal|first2=Puja|last3=Wang|first3=Yamin|last4=Leurgans|first4=Sue E.|last5=Bennett|first5=David A.|last6=Booth|first6=Sarah L.|last7=Morris|first7=Martha Clare|author-link7=Martha Clare Morris|date=2020-01-29|title=Dietary flavonols and risk of Alzheimer dementia|journal=Neurology|language=en|volume=94|issue=16|pages=e1749–e1756|doi=10.1212/WNL.0000000000008981|issn=0028-3878|pmc=7282875|pmid=31996451}}</ref>  It is also found in propolis extracts.<ref>Bertolucci, V., Ninomiya, A. F., Longato, G. B., Kaneko, L. O., Nonose, N., Scariot, P. P. M., & Messias, L. H. D. (2025). Bioactive Compounds from Propolis on Bone Homeostasis: A Narrative Review. Antioxidants, 14(1), 81. https://doi.org/10.3390/antiox14010081</ref> Kaempferol is a yellow crystalline solid with a melting point of {{convert|276-278|C|F}}. It is slightly soluble in water and highly soluble in hot [[ethanol]], [[ethers]], and [[Dimethyl sulfoxide|DMSO]]. Kaempferol is named for 17th-century German naturalist [[Engelbert Kaempfer]].<ref name=MW>[https://www.merriam-webster.com/dictionary/kaempferol Kaempferol] at [[Merriam-Webster]].com; retrieved October 20, 2017</ref>