Quercetinのソースを表示

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 415155335
| Name = Quercetin
| pronounce = {{IPAc-en|ˈ|k|w|ɜːr|s|ᵻ|t|ᵻ|n}}
| ImageFile = Quercetin.svg
| ImageSize = 250px
| ImageAlt = Skeletal formula of quercetin
| ImageFile1 = Quercetin-3D-balls.png
| ImageAlt1 = Ball-and-stick model of the quercetin molecule
| IUPACName = 3,3′,4′,5,7-Pentahydroxyflavone
| SystematicName = 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4''H''-1-benzopyran-4-one
| OtherNames = 5,7,3′,4′-[[flavonol|flavon-3-ol]], Sophoretin, Meletin, Quercetine, Xanthaurine, Quercetol, Quercitin, Quertine, Flavin meletin
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 117-39-5
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo2 = 6151-25-3 
| CASNo2_Comment = (dihydrate)<ref name=PVP>{{Cite web|url=http://www.pvp.com.br/EN_quercetin_dihydrate_safety_data.htm|archive-url=https://web.archive.org/web/20110916172444/http://www.pvp.com.br/EN_quercetin_dihydrate_safety_data.htm|url-status= dead|title=Quercetin dihydrate safety sheet|archive-date=September 16, 2011}}</ref>
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16243
| Beilstein = 317313
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 50
| ChemSpiderID = 4444051
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04216
| EINECS = 204-187-1
| Gmelin = 579210
| IUPHAR_ligand = 5346
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00389
| PubChem = 5280343
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9IKM0I5T1E
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1 = 53B03V78A6
| UNII1_Comment = (dihydrate)
| UNNumber = 2811
| InChI = 1/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H
| InChIKey = REFJWTPEDVJJIY-UHFFFAOYAW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = REFJWTPEDVJJIY-UHFFFAOYSA-N
| SMILES = O=C1c3c(O/C(=C1/O)c2ccc(O)c(O)c2)cc(O)cc3O
}}
|Section2={{Chembox Properties
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>7</sub>
| MolarMass = 302.236&nbsp;g/mol
| Density = 1.799&nbsp;g/cm<sup>3</sup>
| MeltingPtC = 316
| BoilingPt =
| Appearance = yellow crystalline powder<ref name=PVP/>
| Solubility = Practically insoluble in water; soluble in aqueous alkaline solutions<ref name=PVP/>
}}
}}
[[File:Spectre UV vis Quercétine.PNG|thumb|right|UV visible spectrum of quercetin, with lambda max at 369&nbsp;nm]]
'''Quercetin''' is a plant [[flavonol]] from the [[flavonoid]] group of [[polyphenol]]s. It is found in many fruits, vegetables, leaves, seeds, and grains; capers, red onions, and [[kale]] are common foods containing appreciable amounts of it.<ref name="lpi">{{cite web|url=http://lpi.oregonstate.edu/mic/dietary-factors/phytochemicals/flavonoids|title=Flavonoids |publisher=Micronutrient Information Center, Linus Pauling Institute, Oregon State University, Corvallis, OR|date=November 2015|access-date=1 April 2018}}</ref><ref name=usda/> It has a [[bitter flavor]] and is used as an ingredient in [[dietary supplement]]s, beverages, and foods.