Β-Zearalenolのソースを表示

{{Short description|Chemical compound}}
{{lowercase title}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| drug_name = β-Zearalenol
| IUPAC_name = (2''E'',7''S'',11''S'')-7,15,17-trihydroxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(18),2,14,16-tetraen-13-one
| image = Beta Zearalenol.svg
| width =

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = 
| CAS_number = 71030-11-0
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 6437352
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 5908979
| UNII = 35E809PP7O
| KEGG = C14751
| ChEBI = 35072
| ChEMBL =

<!--Chemical data-->
| C=18 | H=24 | O=5
| SMILES = C[C@H]1CCC[C@H](CCC/C=C/C2=CC(=CC(=C2C(=O)O1)O)O)O
| StdInChI_Ref = 
| StdInChI = 1S/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+/t12-,14-/m0/s1
| StdInChIKey_Ref = 
| StdInChIKey = FPQFYIAXQDXNOR-PMRAARRBSA-N
| synonyms = beta-Zearalenol; beta-''trans''-Zearalenol
}}

'''β-Zearalenol''' is a [[nonsteroidal]] [[estrogen]] of the [[resorcylic acid lactone]] group related to [[mycoestrogen]]s found in ''[[Fusarium|Fusarium spp]]''.<ref name="Chelkowski2014">{{cite book | vauthors = Bottalico A, Logrieco A, Visconti A | chapter = Fusarium species and their mycotoxins in infected cereals in the field and in stored grains | title = Fusarium: Mycotoxins, Taxonomy, Pathogenicity | date = January 1989 | pages = 85–119 | veditors = Chelkowski J | chapter-url=https://books.google.com/books?id=_1KeBQAAQBAJ&pg=PA85 |publisher=Elsevier Science |isbn=978-1-4832-9785-9 }}</ref> It is the β [[epimer]] of [[α-zearalenol]] and along with α-zearalenol is a major [[metabolite]] of [[zearalenone]] formed mainly in the [[liver]] but also to a lesser extent in the [[intestine]]s during [[first-pass metabolism]].<ref name="MaganOlsen2004">{{cite book | vauthors = Alldrick AJ, Hajšelová M | chapter = Zearalenone | title = Mycotoxins in Food: Detection and Control | date = January 2004 | pages = 353–366 | publisher =  Woodhead Publishing | veditors = Magan N, Olsen M | chapter-url=https://books.google.com/books?id=CZ3iEhPeejoC&pg=PA356 |isbn=978-1-85573-733-4 }}</ref><ref name="Eriksen1998">{{cite book | chapter = Zearalenone | vauthors = Eriksen GS, Alexander J  |title=Fusarium Toxins in Cereals: A Risk Assessment| chapter-url=https://books.google.com/books?id=jU5Wx8LkZHUC&pg=PA61|year=1998|publisher=Nordic Council of Ministers|isbn=978-92-893-0149-7|pages=61–}}</ref> A relatively high proportion of α-zearalenol is formed from zearalenone compared to β-zearalenol in humans.<ref name="Eriksen1998" /> β-Zearalenol is about the same or slightly less potent as an estrogen relative to zearalenone.<ref name="Chelkowski2014" />

==See also==
* [[Taleranol]] (β-zearalanol)
* [[Zeranol]] (α-zearalanol)
* [[Zearalanone]]

==References==
{{reflist|30em}}

{{Estrogen receptor modulators}}

{{DEFAULTSORT:Zearalenol, alpha-}}
[[Category:Lactones]]
[[Category:Mycoestrogens]]
[[Category:Mycotoxins]]
[[Category:Resorcinols]]