8,9-Dehydroestradiolのソースを表示

{{Short description|Chemical compound}}
{{Infobox drug
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = (13''S'',14''S'',17''S'')-13-methyl-6,7,11,12,14,15,16,17-octahydrocyclopenta[''a'']phenanthrene-3,17-diol
| image = 8,9-Dehydroestradiol.svg
| width = 225px

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = [[Oral administration|By mouth]]
| class = [[Estrogen (medication)|Estrogen]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = 
| CAS_number = 23392-54-3
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 8014038
| UNII = 
| KEGG = 
| ChEBI = 
| ChEMBL = 
| synonyms = Δ<sup>8</sup>-Estradiol; Δ<sup>8</sup>-17β-Estradiol; Estra-1,3,5(10),8-tetraen-17β-ol-3-one

<!--Chemical data-->
| C=18 | H=22 | O=2
| SMILES = Oc4cc3c(/C1=C(/[C@@H]2CC[C@H](O)[C@]2(CC1)C)CC3)cc4
| StdInChI_Ref = 
| StdInChI = InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,16-17,19-20H,2,4,6-9H2,1H3/t16-,17-,18-/m0/s1
| StdInChIKey_Ref = 
| StdInChIKey = UWYDUSMQFLTKBQ-BZSNNMDCSA-N
}}

'''8,9-Dehydroestradiol''', or '''Δ<sup>8</sup>-17β-estradiol''', also known as '''estra-1,3,5(10),8-tetraen-17β-ol-3-one''', is a [[naturally occurring]] [[steroid]]al [[estrogen (medication)|estrogen]] found in [[equine|horse]]s which is closely related to [[equilin]], [[equilenin]], and [[estradiol (medication)|estradiol]], and, as the 3-[[sulfate]] [[ester]] [[sodium]] [[salt (chemistry)|salt]], is a minor constituent of [[conjugated estrogens]] (Premarin).<ref name="FritzSperoff2012">{{cite book| vauthors = Fritz MA, Speroff L |title=Clinical Gynecologic Endocrinology and Infertility|url=https://books.google.com/books?id=KZLubBxJEwEC&pg=PA751|date=28 March 2012|publisher=Lippincott Williams & Wilkins|isbn=978-1-4511-4847-3|pages=751–}}</ref> It is also an important [[active metabolite]] of [[8,9-dehydroestrone]], analogously to conversion of [[estrone]] or [[estrone sulfate]] into estradiol.<ref name="pmid16112947">{{cite journal | vauthors = Kuhl H | title = Pharmacology of estrogens and progestogens: influence of different routes of administration | journal = Climacteric | volume = 8 | issue = Suppl 1 | pages = 3–63 | date = August 2005 | pmid = 16112947 | doi = 10.1080/13697130500148875 | s2cid = 24616324 }}</ref><ref name="pmid10865186">{{cite journal | vauthors = Bhavnani BR, Nisker JA, Martin J, Aletebi F, Watson L, Milne JK | title = Comparison of pharmacokinetics of a conjugated equine estrogen preparation (premarin) and a synthetic mixture of estrogens (C.E.S.) in postmenopausal women | journal = Journal of the Society for Gynecologic Investigation | volume = 7 | issue = 3 | pages = 175–183 | year = 2000 | pmid = 10865186 | doi = 10.1016/s1071-5576(00)00049-6 }}</ref>

== See also ==
* [[List of estrogens#Equine estrogens|List of estrogens § Equine estrogens]]

== References ==
{{Reflist}}

{{Estrogens and antiestrogens}}
{{Estrogen receptor modulators}}

{{DEFAULTSORT:Dehydroestradiol, 8, 9-}}
[[Category:Secondary alcohols]]
[[Category:Estranes]]
[[Category:Estrogens]]


{{Steroid-stub}}
{{Genito-urinary-drug-stub}}