Ent-Estradiolのソースを表示

{{Short description|Chemical compound}}
{{DISPLAYTITLE:''ent''-Estradiol}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = (8''S'',9''R'',13''R'',14''R'',17''R'')-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[''a'']phenanthrene-3,17-diol
| image = ent-Estradiol.svg
| width = 

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = 
| class = [[Estrogen (medication)|Estrogen]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 3736-22-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = VW299DJ6U7
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 667515
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID =  
| KEGG = 
| ChEBI = 
| ChEMBL = 
| synonyms = ''ent''-E2; 1-Estradiol; 1-E2

<!--Chemical data-->
| C=18 | H=24 | O=2 
| SMILES = C[C@@]12CC[C@@H]3[C@@H]([C@H]1CC[C@H]2O)CCC4=C3C=CC(=C4)O
| StdInChI_Ref = 
| StdInChI = 1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m0/s1
| StdInChIKey_Ref = 
| StdInChIKey = VOXZDWNPVJITMN-QXDIGNSFSA-N
}}

'''''ent''-Estradiol''' ('''''ent''-E2'''), or '''1-estradiol''' ('''1-E2'''), is an [[estrogen (medication)|estrogen]] and the 1-[[enantiomorph]] of [[estradiol (medication)|estradiol]].<ref name="pmid5821989">{{cite journal | vauthors = Edgren RA, Jones RC | title = An anti-estradiol effect of ent-estradiol-17beta (1-estradiol) | journal = Steroids | volume = 14 | issue = 3 | pages = 335–41 | date = September 1969 | pmid = 5821989 | doi = 10.1016/0039-128x(69)90021-x }}</ref><ref name="pmid4347201">{{cite journal | vauthors = Terenius L, Ljungkvist I | title = Aspects on the mode of action of antiestrogens and antiprogestogens | journal = Gynecol Invest | volume = 3 | issue = 1 | pages = 96–107 | date = 1972 | pmid = 4347201 | doi = 10.1159/000301746 }}</ref><ref name="pmid5104534">{{cite journal | vauthors = Terenius L | title = The Allen-Doisy test for estrogens reinvestigated | journal = Steroids | volume = 17 | issue = 6 | pages = 653–61 | date = June 1971 | pmid = 5104534 | doi = 10.1016/0039-128x(71)90081-x }}</ref> It is a so-called "short-acting" or "impeded" estrogen, similarly to [[estriol (medication)|estriol]], [[alfatradiol|17α-estradiol]], and [[dimethylstilbestrol]].<ref name="pmid5821989" /><ref name="pmid4347201" /><ref name="pmid5104534" />

==References==
{{Reflist}}


{{Estrogen receptor modulators}}

{{DEFAULTSORT:Estradiol, ent-}}

[[Category:Abandoned drugs]]
[[Category:Secondary alcohols]]
[[Category:Estranes]]
[[Category:Estrogens]]
[[Category:Hydroxyarenes]]


{{Steroid-stub}}
{{Genito-urinary-drug-stub}}