Estradiol 17β-benzoateのソースを表示

{{Short description|Chemical compound}}
{{Distinguish|Estradiol benzoate}}
{{Infobox drug
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = [(8''R'',9''S'',13''S'',14''S'',17''S'')-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[''a'']phenanthren-17-yl] benzoate
| image = Estradiol 17β-benzoate.svg
| width =

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = 
| class = [[Estrogen (medication)|Estrogen]]; [[Estrogen ester]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = 
| CAS_number = 983-30-2
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 66420
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 59794
| UNII = 3GFX41Z289
| KEGG = 
| ChEBI = 
| ChEMBL = 
| synonyms = E2-17B; ZYC30

<!--Chemical data-->
| C=25 | H=28 | O=3
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)C4=CC=CC=C4)CCC5=C3C=CC(=C5)O
| StdInChI_Ref = 
| StdInChI = 1S/C25H28O3/c1-25-14-13-20-19-10-8-18(26)15-17(19)7-9-21(20)22(25)11-12-23(25)28-24(27)16-5-3-2-4-6-16/h2-6,8,10,15,20-23,26H,7,9,11-14H2,1H3/t20-,21-,22+,23+,25+/m1/s1
| StdInChIKey_Ref = 
| StdInChIKey = AAGOOGMSOHOVSE-BZDYCCQFSA-N
}}

'''Estradiol 17β-benzoate''' ('''E2-17B''') is an [[estrogen (medication)|estrogen]] and an [[estrogen ester]]—specifically, the C17β [[benzoate]] [[ester]] of [[estradiol (medication)|estradiol]]—which was never marketed.<ref name="pmid13531579">{{cite journal | vauthors = Junkmann K, Witzel H | title = [Chemistry and pharmacology of steroid hormone esters] | language = de | journal = Zeitschrift für Vitamin-, Hormon- und Fermentforschung | volume = 9 | issue = 1–2 | pages = 97–143 contd | date = 1957 | pmid = 13531579 | trans-title = Chemistry and pharmacology of steroid hormone esters }}</ref><ref name="PerezCai2005">{{cite journal| vauthors = Perez E, Cai ZY, Covey DF, Simpkins JW |title=Neuroprotective effects of estratriene analogs: structure-activity relationships and molecular optimization|journal=Drug Development Research|volume=66|issue=2|year=2005|pages=78–92|issn=0272-4391|doi=10.1002/ddr.20047|s2cid=86133327}}</ref><ref name="pmid21111714">{{cite journal | vauthors = Yi KD, Perez E, Yang S, Liu R, Covey DF, Simpkins JW | title = The assessment of non-feminizing estrogens for use in neuroprotection | journal = Brain Research | volume = 1379 | pages = 61–70 | date = March 2011 | pmid = 21111714 | pmc = 3048764 | doi = 10.1016/j.brainres.2010.11.058 }}</ref> It is the C17β [[positional isomer]] of the better-known and clinically used [[estradiol ester]] [[estradiol benzoate]] (estradiol 3-benzoate; Progynon-B).<ref name="pmid13531579" /> Estradiol 17β-benzoate was first described in the 1930s.<ref name="pmid16746375">{{cite journal | vauthors = Parkes AS | title = Relative duration of action of various esters of oestrone, oestradiol and oestriol | journal = The Biochemical Journal | volume = 31 | issue = 4 | pages = 579–585 | date = April 1937 | pmid = 16746375 | pmc = 1266977 | doi = 10.1042/bj0310579 }}</ref>

== See also ==
* [[List of estrogen esters#Estradiol esters|List of estrogen esters § Estradiol esters]]

== References ==
{{Reflist}}

{{Estrogen receptor modulators}}

[[Category:Abandoned drugs]]
[[Category:Benzoate esters]]
[[Category:Estradiol esters]]
[[Category:Secondary alcohols]]
[[Category:Synthetic estrogens]]


{{Steroid-stub}}
{{Genito-urinary-drug-stub}}