Estradiol 3-glucuronide 17β-sulfateのソースを表示

{{Chembox
<!-- Images -->
| ImageFile = Estradiol 3-glucuronide 17β-sulfate.svg
| ImageSize = 
| ImageAlt = 
<!-- Names -->
| IUPACName = 17β-(Sulfooxy)estra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronic acid
| SystematicName = (2''S'',3''S'',4''S'',5''R'',6''S'')-3,4,5-Trihydroxy-6-<nowiki/>{[(1''S'',3a''S'',3b''R'',9b''S'',11a''S'')-11a-methyl-1-(sulfooxy)-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1''H''-cyclopenta[''a'']phenanthren-7-yl]oxy}oxane-2-carboxylic acid
| OtherNames = E2-3G-17S
<!-- Sections -->
| Section1 = {{Chembox Identifiers
| CASNo = 84123-28-4
| CASNo_Ref = {{Cascite|changed|CAS}}
| ChEBI = 79720
| ChemSpiderID = 10128415
| InChI = 1S/C24H32O11S/c1-24-9-8-14-13-5-3-12(33-23-20(27)18(25)19(26)21(34-23)22(28)29)10-11(13)2-4-15(14)16(24)6-7-17(24)35-36(30,31)32/h3,5,10,14-21,23,25-27H,2,4,6-9H2,1H3,(H,28,29)(H,30,31,32)/t14-,15-,16+,17+,18+,19+,20-,21+,23-,24+/m1/s1
| InChIKey = XZXBPAODZJETKT-QXYWQCSFSA-N
| KEGG = C15207
| PubChem = 11954120
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OS(=O)(=O)O)CCC4=C3C=CC(=C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C(=O)O)O)O)O
  }}
| Section2 = {{Chembox Properties
| C=24 | H=32 | O=11 | S=1
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
| Section3 = {{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
  }}
}}

'''Estradiol 3-glucuronide 17β-sulfate''' ('''E2-3G-17S''') is an [[endogenous]] [[estrogen conjugate]] and [[metabolite]] of [[estradiol]].<ref name="pmid12564690">{{cite journal | vauthors = Isobe T, Shiraishi H, Yasuda M, Shinoda A, Suzuki H, Morita M | title = Determination of estrogens and their conjugates in water using solid-phase extraction followed by liquid chromatography-tandem mass spectrometry | journal = J Chromatogr A | volume = 984 | issue = 2 | pages = 195–202 | date = January 2003 | pmid = 12564690 | doi = 10.1016/s0021-9673(02)01851-4 }}</ref><ref name="pmid12833391">{{cite journal | vauthors = Katayama M, Matsuda Y, Shimokawa K, Kaneko S | title = Simultaneous determination of 16 estrogens, dehydroepiandrosterone and their glucuronide and sulfate conjugates in serum using sodium cholate micelle capillary electrophoresis | journal = Biomed. Chromatogr. | volume = 17 | issue = 4 | pages = 263–7 | date = June 2003 | pmid = 12833391 | doi = 10.1002/bmc.236 | doi-access = free }}</ref> It is related to [[estradiol 3-sulfate]] and [[estradiol 17β-glucuronide]].<ref name="pmid12564690" /><ref name="pmid12833391" /> Estradiol 3-glucuronide 17β-sulfate has 0.0001% of the [[relative binding affinity]] of estradiol for the [[ERα]], one of the two [[estrogen receptor]]s (ERs).<ref name="pmid24063761">{{cite journal | vauthors = Durmaz V, Schmidt S, Sabri P, Piechotta C, Weber M | title = Hands-off linear interaction energy approach to binding mode and affinity estimation of estrogens | journal = J Chem Inf Model | volume = 53 | issue = 10 | pages = 2681–8 | date = October 2013 | pmid = 24063761 | doi = 10.1021/ci400392p }}</ref> It shows less than one million-fold lower [[potency (pharmacology)|potency]] in activating the [[estrogen receptor]]s relative to estradiol ''[[in vitro]]''.<ref name="pmid9294720">{{cite journal | vauthors = Coldham NG, Dave M, Sivapathasundaram S, McDonnell DP, Connor C, Sauer MJ | title = Evaluation of a recombinant yeast cell estrogen screening assay | journal = Environ. Health Perspect. | volume = 105 | issue = 7 | pages = 734–42 | date = July 1997 | pmid = 9294720 | pmc = 1470103 | doi = 10.1289/ehp.97105734 }}</ref>

==See also==
* [[Catechol estrogen]]
* [[Estrogen conjugate]]
* [[Lipoidal estradiol]]
* [[List of estrogen esters#Estradiol esters|List of estrogen esters § Estradiol esters]]

==References==
{{Reflist}}


{{Steroid hormones}}
{{Estrogen receptor modulators}}

[[Category:Estradiol esters]]
[[Category:Human metabolites]]
[[Category:Phenol esters]]
[[Category:Sulfate esters]]


{{Steroid-stub}}