Estradiol disulfateのソースを表示

{{short description|Chemical compound}}
{{Chembox
<!-- Images -->
| ImageFile = Estradiol disulfate.svg
| ImageSize = 200px
| ImageAlt = 
<!-- Names -->
| IUPACName = [(8''R'',9''S'',13''S'',14''S'',17''S'')-13-Methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[''a'']phenanthren-17-yl] hydrogen sulfate
| OtherNames = E2DS; Estradiol 3,17β-disulfate
<!-- Sections -->
| Section1 = {{Chembox Identifiers
| CASNo = 3233-70-3
| ChEMBL = 1162492
| ChemSpiderID = 59803
| InChI = 1S/C18H24O8S2/c1-18-9-8-14-13-5-3-12(25-27(19,20)21)10-11(13)2-4-15(14)16(18)6-7-17(18)26-28(22,23)24/h3,5,10,14-17H,2,4,6-9H2,1H3,(H,19,20,21)(H,22,23,24)/t14-,15-,16+,17+,18+/m1/s1
| InChIKey = VPLAJGAMHNQZIY-ZBRFXRBCSA-N
| KEGG = C045407
| PubChem = 66430
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OS(=O)(=O)O)CCC4=C3C=CC(=C4)OS(=O)(=O)O
  }}
| Section2 = {{Chembox Properties
| C=18 | H=24 | O=8 | S=2
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
| Section3 = {{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
  }}
}}

'''Estradiol disulfate''' (also known as '''E2DS''' or '''estradiol 3,17β-disulfate''') is an [[endogenous]] [[estrogen conjugate]] and [[metabolite]] of [[estradiol]].<ref name=":0">{{Citation |last1=Herr |first1=F. |title=Biological Properties of Estrogen Sulfates |date=1970 |work=Chemical and Biological Aspects of Steroid Conjugation |pages=368–408 |editor-last=Bernstein |editor-first=Seymour |place=Berlin, Heidelberg |publisher=Springer |language=en |doi=10.1007/978-3-642-95177-0_8 |isbn=978-3-642-95177-0 |last2=Revesz |first2=C. |last3=Manson |first3=A. J. |last4=Jewell |first4=J. B. |doi-broken-date=21 January 2025 |editor2-last=Solomon |editor2-first=Samuel }}</ref> It is related to [[estradiol 3-sulfate]] and [[estradiol 17β-sulfate]].<ref name=":0" /> Estradiol disulfate has 0.0004% of the [[relative binding affinity]] of estradiol for the [[estrogen receptor alpha]] (ERα), one of the two [[estrogen receptor]]s (ERs).<ref name="pmid24063761">{{cite journal | vauthors = Durmaz V, Schmidt S, Sabri P, Piechotta C, Weber M | title = Hands-off linear interaction energy approach to binding mode and affinity estimation of estrogens | journal = J Chem Inf Model | volume = 53 | issue = 10 | pages = 2681–8 | date = October 2013 | pmid = 24063761 | doi = 10.1021/ci400392p }}</ref>

== See also ==
* [[Catechol estrogen]]
* [[Estrogen conjugate]]
* [[Lipoidal estradiol]]
* [[List of estrogen esters#Estradiol esters|List of estrogen esters § Estradiol esters]]

== References ==
{{Reflist}}

{{Estradiol salts}}
{{Estradiol}}
{{Steroid hormones}}
{{Estrogen receptor modulators}}

[[Category:Estradiol esters]]
[[Category:Human metabolites]]
[[Category:Phenol esters]]
[[Category:Sulfate esters]]


{{Steroid-stub}}