Estrone methyl etherのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = (8''R'',9''S'',13''S'',14''S'')-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6''H''-cyclopenta[''a'']phenanthren-17-one
| image = Estrone methyl ether.svg
| width = 225px

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = 
| class = [[Estrogen (medication)|Estrogen]]; [[Estrogen ether]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 

<!-- Identifiers -->
| CAS_number_Ref = 
| CAS_number = 1624-62-0
| CAS_supplemental = <br />1091-94-7
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 92895
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 
| UNII = 4SMZ4A51IJ
| KEGG = 
| ChEBI = 
| ChEMBL = 1409077
| synonyms = Oestrone methyl ether; Estrone 3-methyl ether; 3-Methoxyestrone; 3-Methoxyestra-1,3,5(10)-trien-17-one

<!--Chemical data-->
| C=19 | H=24 | O=2
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OC
| StdInChI_Ref = 
| StdInChI = 1S/C19H24O2/c1-19-10-9-15-14-6-4-13(21-2)11-12(14)3-5-16(15)17(19)7-8-18(19)20/h4,6,11,15-17H,3,5,7-10H2,1-2H3/t15-,16-,17+,19+/m1/s1
| StdInChIKey_Ref = 
| StdInChIKey = BCWWDWHFBMPLFQ-VXNCWWDNSA-N
}}

'''Estrone methyl ether''', or '''estrone 3-methyl ether''', is a [[synthetic compound|synthetic]] [[estrogen (medication)|estrogen]] and [[estrogen ether]] – specifically, the C3 [[methyl group|methyl]] [[ether]] of [[estrone (medication)|estrone]] – which was never marketed.<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA900|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=900–}}</ref><ref name="Milne2018">{{cite book| vauthors = Milne GW |title=Drugs: Synonyms and Properties: Synonyms and Properties|url=https://books.google.com/books?id=xUlaDwAAQBAJ&pg=PT1406|date=8 May 2018|publisher=Taylor & Francis|isbn=978-1-351-78989-9|pages=1406–}}</ref> It has been used to [[chemical synthesis|synthesize]] [[mestranol]] ([[ethinylestradiol]] 3-methyl ether).<ref name="Ravina2011">{{cite book| vauthors = Ravina E |title=The Evolution of Drug Discovery: From Traditional Medicines to Modern Drugs|url=https://books.google.com/books?id=iDNy0XxGqT8C&pg=PA190|date=11 January 2011|publisher=John Wiley & Sons|isbn=978-3-527-32669-3|pages=190–}}</ref>

==See also==
* [[List of estrogen esters#Ethers of steroidal estrogens|List of estrogen esters § Ethers of steroidal estrogens]]

==References==
{{Reflist}}


{{Estrogen receptor modulators}}

[[Category:Abandoned drugs]]
[[Category:Estranes]]
[[Category:Estrogen ethers]]
[[Category:Ketones]]
[[Category:Synthetic estrogens]]


{{Steroid-stub}}
{{Genito-urinary-drug-stub}}