HPTEのソースを表示

{{chembox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| ImageFile = 2,2-bis(p-hydroxyphenyl)-1,1,1-trichloroethane.svg
| ImageSize = 250px
| ImageAlt = 
| ImageFile1 = 
| ImageSize1 = 
| ImageAlt1 = 
| PIN = 4,4′-(2,2,2-Trichloroethane-1,1-diyl)diphenol
| OtherNames = ''<nowiki>p,p'</nowiki>''-Hydroxy-DDT<br/>Hydroxychlor<br/>2,2-bis(p-hydroxyphenyl)-1,1,1-trichloroethane<br/>1,1,1-Trichloro-2,2-bis(4-hydroxyphenyl)ethane
|Section1={{Chembox Identifiers
| Abbreviations = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 68781
| Beilstein = 2054671
| DTXSID = DTXSID8022325
| EINECS = 623-854-1
| UNII_Ref = 
| UNII = H58165YO91
| KEGG_Ref = 
| KEGG = C14136
| InChI = 1S/C14H11Cl3O2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13,18-19H
| InChIKey = IUGDILGOLSSKNE-UHFFFAOYSA-N
| ChEMBL_Ref = 
| ChEMBL = 196585
| StdInChI_Ref = 
| StdInChI = 1S/C14H11Cl3O2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13,18-19H
| StdInChIKey_Ref = 
| StdInChIKey = IUGDILGOLSSKNE-UHFFFAOYSA-N
| CASNo = 2971-36-0
| CASNo_Ref = 
| PubChem = 76302
| ChEBI_Ref = 
| ChEBI = 34025
| SMILES = C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C(Cl)(Cl)Cl)O
}}
|Section2={{Chembox Properties
| C=14 | H=11 | Cl=3 | O=2
| MolarMass = 
| Appearance = 
| Odor = 
| Density = 
| MeltingPtC = 
| BoilingPt = 
| Solubility = 
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| PEL = 
| IDLH = 
| REL = 
| LD50 =
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|315|319|335}}
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}
}}
}}

'''HPTE''', also known as '''hydroxychlor''', '''''<nowiki>p,p'</nowiki>''-hydroxy-DDT''', or '''2,2-bis(4-hydroxyphenyl)-1,1,1-trichloroethane''', is a [[metabolite]] of [[methoxychlor]], a [[synthetic compound|synthetic]] [[insecticide]] related to [[DDT]].<ref>{{cite journal |last1=Leung-Gurung |first1=Lucie |last2=Escalante Cobb |first2=Priscilla |last3=Mourad |first3=Faraj |last4=Zambrano |first4=Cristina |last5=Muscato |first5=Zachary |last6=Sanchez |first6=Victoria |last7=Godde |first7=Kanya |last8=Broussard |first8=Christine |title=Methoxychlor metabolite HPTE alters viability and differentiation of embryonic thymocytes from C57BL/6 mice |journal=Journal of Immunotoxicology |date=4 July 2018 |volume=15 |issue=1 |pages=104–118 |doi=10.1080/1547691X.2018.1474978|pmid=29973080 |pmc=6120686 |doi-access=free }}</ref> Like [[bisphenol A]] with similar [[chemical structure]], HPTE is an [[endocrine disruptor]] which has [[estrogen (medication)|estrogen]]ic activity,<ref>{{cite journal |last1=Hewitt |first1=Sylvia C. |last2=Korach |first2=Kenneth S. |title=Estrogenic Activity of Bisphenol A and 2,2-bis(p-Hydroxyphenyl)-1,1,1-trichloroethane (HPTE) Demonstrated in Mouse Uterine Gene Profiles |journal=Environmental Health Perspectives |date=January 2011 |volume=119 |issue=1 |pages=63–70 |doi=10.1289/EHP.1002347|pmid=20826375 |pmc=3018502 }}</ref> and also inhibits [[Cholesterol side-chain cleavage enzyme]] (P450scc, CYP11A1)<ref>{{cite journal |last1=Akgul |first1=Yucel |last2=Derk |first2=Raymond C. |last3=Meighan |first3=Terence |last4=Rao |first4=K. Murali Krishna |last5=Murono |first5=Eisuke P. |title=The methoxychlor metabolite, HPTE, inhibits rat luteal cell progesterone production |journal=Reproductive Toxicology |date=July 2011 |volume=32 |issue=1 |pages=77–84 |doi=10.1016/J.REPROTOX.2011.05.013|pmid=21664964 }}</ref> and [[3α-hydroxysteroid dehydrogenase]] (3α-HSD).<ref>{{cite journal |last1=Mao |first1=Baiping |last2=Wu |first2=Chengyun |last3=Zheng |first3=Wenwen |last4=Shen |first4=Qiuxia |last5=Wang |first5=Yiyan |last6=Wang |first6=Qiufan |last7=Lin |first7=Han |last8=Li |first8=Xiaoheng |last9=Sun |first9=Jianliang |last10=Ge |first10=Ren-Shan |title=Methoxychlor and its metabolite HPTE inhibit rat neurosteroidogenic 3α-hydroxysteroid dehydrogenase and retinol dehydrogenase 2 |journal=Neuroscience Letters |date=September 2018 |volume=684 |pages=169–174 |doi=10.1016/j.neulet.2018.08.008|pmid=30107201 |s2cid=52004606 }}</ref>

==References==
{{Reflist}}

{{Estrogen receptor modulators}}

[[Category:3α-Hydroxysteroid dehydrogenase inhibitors]]
[[Category:Cholesterol side-chain cleavage enzyme inhibitors]]
[[Category:Endocrine disruptors]]
[[Category:4-Hydroxyphenyl compounds]]
[[Category:Trichloromethyl compounds]]
[[Category:Xenoestrogens]]


{{drug-stub}}