Methylpiperidinopyrazoleのソースを表示

{{short description|Chemical compound}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = 4-[2-(4-hydroxyphenyl)-4-methyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1H-pyrazol-5-ylidene]cyclohexa-2,5-dien-1-one
| image = Methylpiperidinopyrazole.svg
| width =

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!--Identifiers-->
| CAS_number_Ref = 
| CAS_number = 289726-02-9
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| PubChem = 6604927
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 5037183

<!--Chemical data-->
| C=29 | H=31 | N=3 | O=3
| smiles = CC1=C(N(NC1=C2C=CC(=O)C=C2)C3=CC=C(C=C3)O)C4=CC=C(C=C4)OCCN5CCCCC5
| StdInChI = 1S/C29H31N3O3/c1-21-28(22-5-11-25(33)12-6-22)30-32(24-9-13-26(34)14-10-24)29(21)23-7-15-27(16-8-23)35-20-19-31-17-3-2-4-18-31/h5-16,30,34H,2-4,17-20H2,1H3
| StdInChIKey = PFTIONINVMINHE-UHFFFAOYSA-N
| synonyms = 
}}

'''Methylpiperidinopyrazole''' ('''MPP''') is a [[synthetic compound|synthetic]], [[nonsteroidal]], and highly selective [[receptor antagonist|antagonist]] of [[Estrogen receptor alpha|ERα]] that is used in [[scientific research]] to study the function of this [[receptor (biochemistry)|receptor]].<ref name="pmid11861516">{{cite journal | vauthors = Sun J, Huang YR, Harrington WR, Sheng S, Katzenellenbogen JA, Katzenellenbogen BS | title = Antagonists selective for estrogen receptor alpha | journal = Endocrinology | volume = 143 | issue = 3 | pages = 941–7 | date = March 2002 | pmid = 11861516 | doi = 10.1210/endo.143.3.8704 | doi-access = free }}</ref><ref name="pmid19014882">{{cite journal | vauthors = Zhou HB, Carlson KE, Stossi F, Katzenellenbogen BS, Katzenellenbogen JA | title = Analogs of methyl-piperidinopyrazole (MPP): antiestrogens with estrogen receptor alpha selective activity | journal = Bioorganic & Medicinal Chemistry Letters | volume = 19 | issue = 1 | pages = 108–10 | date = January 2009 | pmid = 19014882 | pmc = 2711511 | doi = 10.1016/j.bmcl.2008.11.006 }}</ref> It has 200-fold selectivity for ERα over [[ERβ]] and 1000-fold selectivity for blocking ERα-mediated gene transcription relative to that of ERβ.<ref name="OttowWeinmann2008">{{cite book| vauthors = Ottow E, Weinmann H |title=Nuclear Receptors as Drug Targets|url=https://books.google.com/books?id=iATfLbPgRugC&pg=PA50|date=8 September 2008|publisher=John Wiley & Sons|isbn=978-3-527-62330-3|pages=50–}}</ref>

==See also==
* [[Glyceollin]]
* [[Propylpyrazoletriol]] (PPT)
* [[Diarylpropionitrile]] (DPN)
* [[Prinaberel]] (ERB-041)
* [[Liquiritigenin]]
* [[Menerba]]
* [[PHTPP]]
* [[(R,R)-Tetrahydrochrysene]] ((R,R)-THC)

==References==
{{reflist|30em}}

{{Estrogenics}}

[[Category:Antiestrogens]]
[[Category:1-Piperidinyl compounds]]
[[Category:Phenol ethers]]
[[Category:4-Hydroxyphenyl compounds]]
[[Category:Pyrazoles]]

{{genito-urinary-drug-stub}}