Prinaberelのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name               = (4''Z'')-2-Fluoro-4-(5-hydroxy-7-vinyl-1,3-benzoxazol-2(3''H'')-ylidene)-2,5-cyclohexadien-1-one
| image                    = Prinaberel.svg
| width                    = 250
| CAS_number               = 524684-52-4
| CAS_supplemental         = 
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = A9C8MNF7CA
| ATC_prefix               = None
| ATC_suffix               = 
| PubChem                  = 5326893
| ChemSpiderID             = 4484184
| C=15 | H=10 | F=1 | N=1 | O=3
| smiles                   = O=C3\C=C/C(=C2/Oc1c(cc(O)cc1N2)\C=C)/C=C3/F
| StdInChI                 = 1S/C15H10FNO3/c1-2-8-5-10(18)7-12-14(8)20-15(17-12)9-3-4-13(19)11(16)6-9/h2-7,17-18H,1H2/b15-9-
| StdInChIKey              = FCXYSEXZEGPLGG-DHDCSXOGSA-N
| bioavailability          = 
| protein_bound            = 
| metabolism               = 
| elimination_half-life    = 
| excretion                = 
| pregnancy_category       = 
| legal_status             = 
| routes_of_administration = 
}}

'''Prinaberel''' ([[International Nonproprietary Name|INN]], [[United States Adopted Name|USAN]]) (developmental code names '''ERB-041''', '''WAY-202041''') is a [[synthetic compound|synthetic]], [[nonsteroidal]], and highly [[binding selectivity|selective]] [[agonist]] of the [[estrogen receptor beta|ERβ]] [[isoform|subtype]] of the [[estrogen receptor]].<ref name="pmid14500559">{{cite journal  |vauthors=Harris HA, Albert LM, Leathurby Y, etal | title = Evaluation of an estrogen receptor-beta agonist in animal models of human disease | journal = Endocrinology | volume = 144 | issue = 10 | pages = 4241–9 |date=October 2003 | pmid = 14500559 | doi = 10.1210/en.2003-0550 | url = http://endo.endojournals.org/cgi/pmidlookup?view=long&pmid=14500559| doi-access = free }}</ref> It is used in [[scientific research]] to elucidate the role of the ERβ receptor.<ref name="pmid15857973">{{cite journal |vauthors=Koehler KF, Helguero LA, Haldosén LA, Warner M, Gustafsson JA | title = Reflections on the discovery and significance of estrogen receptor beta | journal = Endocrine Reviews | volume = 26 | issue = 3 | pages = 465–78 |date=May 2005 | pmid = 15857973 | doi = 10.1210/er.2004-0027 | url = http://edrv.endojournals.org/cgi/pmidlookup?view=long&pmid=15857973| doi-access = free }}</ref> Studies have indicated that selective ERβ agonists like prinaberel could be useful in the clinical treatment of a variety of [[medical condition]]s including [[inflammatory bowel disease]], [[rheumatoid arthritis]], [[endometriosis]], and [[sepsis]].<ref name="pmid17824176">{{cite journal | author = Harris HA | title = Preclinical characterization of selective estrogen receptor beta agonists: new insights into their therapeutic potential | journal = Ernst Schering Foundation Symposium Proceedings | volume = 2006/1| issue = 1 | pages = 149–61 | year = 2006 | pmid = 17824176 | doi = 10.1007/2789_2006_021| isbn = 978-3-540-49547-5 }}</ref> Accordingly, prinaberel either was or still is under investigation by [[Wyeth]] for the treatment of some of these conditions.<ref name="Wyeth2006">{{cite web | url = http://business.highbeam.com/436989/article-1G1-146524305/prinaberel-wyeth-phase-change-ii-usa | archive-url = https://web.archive.org/web/20160307162827/https://business.highbeam.com/436989/article-1G1-146524305/prinaberel-wyeth-phase-change-ii-usa | url-status = dead | archive-date = 2016-03-07 | title = Prinaberel - Wyeth phase change II, USA (endometriosis) | date = 2006-06-05 | work = R & D Focus Drug News | access-date = 2012-05-20}}</ref>

==See also==
* [[Diarylpropionitrile]]
* [[ERB-196]]
* [[Erteberel]]
* [[WAY-200070]]
* [[WAY-214156]]

==References==
{{Reflist|2}}

==External links==
* [http://adisinsight.springer.com/drugs/800020667 Prinaberel - AdisInsight]


{{Estrogen receptor modulators}}

[[Category:Benzoxazoles]]
[[Category:Fluoroarenes]]
[[Category:Selective ERβ agonists]]


{{genito-urinary-drug-stub}}