Propylpyrazoletriolのソースを表示

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = 4-[2,3-bis(4-hydroxyphenyl)-4-propyl-1H-pyrazol-5-ylidene]cyclohexa-2,5-dien-1-one
| image = Propylpyrazoletriol.svg
| width =

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!--Identifiers-->
| CAS_number_Ref = 
| CAS_number = 263717-53-9
| CAS_supplemental = 
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0T83Y6JZPF
| ATC_prefix = 
| ATC_suffix = 
| PubChem = 6095481
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 16142497

<!--Chemical data-->
| C=24 | H=22 | N=2 | O=3
| smiles = CCCC1=C(N(NC1=C2C=CC(=O)C=C2)C3=CC=C(C=C3)O)C4=CC=C(C=C4)O
| StdInChI = 1S/C24H22N2O3/c1-2-3-22-23(16-4-10-19(27)11-5-16)25-26(18-8-14-21(29)15-9-18)24(22)17-6-12-20(28)13-7-17/h4-15,25,28-29H,2-3H2,1H3
| StdInChIKey = UOSWGERPQQOSHS-UHFFFAOYSA-N
| synonyms = 
}}

'''Propylpyrazoletriol''' ('''PPT''') is a [[synthetic compound|synthetic]], [[nonsteroidal]] [[agonist]] of [[Estrogen receptor alpha|ERα]] with 400-fold selectivity over [[ERβ]]<ref name="OttowWeinmann2008">{{cite book | vauthors = Weatherman RV | chapter = Untangling the Estrogen Receptor Web: Tools to Selectively Study Estrogen‐Binding Receptors | veditors = Ottow E, Weinmann H |title=Nuclear Receptors as Drug Targets | series = Methods and Principles in Medicinal Chemistry | pages = 47–64 ([https://books.google.com/books?id=iATfLbPgRugC&pg=PA50 50]) |date=8 September 2008|publisher=John Wiley & Sons|isbn=978-3-527-62330-3  | doi = 10.1002/9783527623297.ch3 }}</ref> that is used widely in [[scientific research]] to study the function of [[Estrogen receptor alpha|ERα]].<ref name="PlantZeleznik2014">{{cite book| vauthors = Pfaus JG, Jones SL, Flanagan-Cato LM, Blaustein JD | chapter = Female sexual behavior: Hormonal Priming and Control | veditors = Plant TM, Zeleznik AJ |title=Knobil and Neill's Physiology of Reproduction: Two-Volume Set | volume = 2 | chapter-url=https://www.researchgate.net/publication/282594468 |date=15 November 2014|publisher=Academic Press|isbn=978-0-12-397769-4|pages=2287-2370 (2311) }}</ref><ref name="pmid20977477">{{cite journal | vauthors = Aguirre C, Jayaraman A, Pike C, Baudry M | title = Progesterone inhibits estrogen-mediated neuroprotection against excitotoxicity by down-regulating estrogen receptor-β | journal = Journal of Neurochemistry | volume = 115 | issue = 5 | pages = 1277–87 | date = December 2010 | pmid = 20977477 | pmc = 3010223 | doi = 10.1111/j.1471-4159.2010.07038.x }}</ref><ref>{{cite thesis | vauthors = Mann MK | degree = Ph.D. | publisher = University of Illinois at Urbana-Champaign |title=Synthesis of Non-steroidal Estrogen Receptor Proteolysis Targeting Chimeric Molecules (PROTACS).|url=https://www.proquest.com/openview/4482238ffd6011e4d9945c0a5e196298/1?pq-origsite=gscholar&cbl=18750 |year=2008 |pages=11–}}</ref> Though originally thought to be highly selective for ERα, PPT has subsequently been found to also act as an [[agonist]] of the [[GPER]] (GPR30).<ref name="ProssnitzBarton2014">{{cite journal | vauthors = Prossnitz ER, Barton M | title = Estrogen biology: new insights into GPER function and clinical opportunities | journal = Molecular and Cellular Endocrinology | volume = 389 | issue = 1–2 | pages = 71–83 | date = May 2014 | pmid = 24530924 | pmc = 4040308 | doi = 10.1016/j.mce.2014.02.002 }}</ref>

== See also ==
* [[ERA-45]]
* [[ERA-63]]
* [[GTx-758]]
* [[Methylpiperidinopyrazole]] (MPP)

== References ==
{{Reflist}}

{{Estrogen receptor modulators}}

[[Category:GPER agonists]]
[[Category:Ketones]]
[[Category:4-Hydroxyphenyl compounds]]
[[Category:Pyrazoles]]
[[Category:Synthetic estrogens]]

{{pharmacology-stub}}